About 1-(1H-indol-3-yl)-N,N-dimethylmethanamine
1-(1H-indol-3-yl)-N,N-dimethylmethanamine (PubChem CID 6890) has the molecular formula C11H14N2
and a molecular weight of 174.25 g/mol. Its IUPAC name is 1-(1H-indol-3-yl)-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-(1H-indol-3-yl)-N,N-dimethylmethanamine |
| PubChem CID | 6890 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 1-(1H-indol-3-yl)-N,N-dimethylmethanamine |
| SMILES | CN(C)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C11H14N2/c1-13(2)8-9-7-12-11-6-4-3-5-10(9)11/h3-7,12H,8H2,1-2H3 |
| InChIKey | OCDGBSUVYYVKQZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(1H-indol-3-yl)-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1H-indol-3-yl)-N,N-dimethylmethanamine?
The IUPAC name of 1-(1H-indol-3-yl)-N,N-dimethylmethanamine (CID 6890) is 1-(1H-indol-3-yl)-N,N-dimethylmethanamine.
What is the SMILES notation for 1-(1H-indol-3-yl)-N,N-dimethylmethanamine?
The canonical SMILES for 1-(1H-indol-3-yl)-N,N-dimethylmethanamine is CN(C)Cc1c[nH]c2ccccc12.
What is the InChIKey of 1-(1H-indol-3-yl)-N,N-dimethylmethanamine?
The InChIKey is OCDGBSUVYYVKQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2/c1-13(2)8-9-7-12-11-6-4-3-5-10(9)11/h3-7,12H,8H2,1-2H3.
What are the key properties of 1-(1H-indol-3-yl)-N,N-dimethylmethanamine?
1-(1H-indol-3-yl)-N,N-dimethylmethanamine has a molecular weight of 174.25 g/mol, XLogP of 2.23, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1H-indol-3-yl)-N,N-dimethylmethanamine is sourced from PubChem (CID 6890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).