C22H24F2N6O — CID 68900378
5-(3-amino-2,5-difluorophenyl)-1-methyl-3-[[5-(4-methylpiperazin-1-yl)-2-pyridinyl]amino]pyridin-2-one (PubChem CID 68900378) has the molecular formula C22H24F2N6O and a molecular weight of 426.47 g/mol. Its IUPAC name is 5-(3-amino-2,5-difluorophenyl)-1-methyl-3-[[5-(4-methylpiperazin-1-yl)-2-pyridinyl]amino]pyridin-2-one.
| Compound Name | 5-(3-amino-2,5-difluorophenyl)-1-methyl-3-[[5-(4-methylpiperazin-1-yl)-2-pyridinyl]amino]pyridin-2-one |
|---|---|
| PubChem CID | 68900378 |
| Molecular Formula | C22H24F2N6O |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | 5-(3-amino-2,5-difluorophenyl)-1-methyl-3-[[5-(4-methylpiperazin-1-yl)-2-pyridinyl]amino]pyridin-2-one |
| SMILES | CN1CCN(c2ccc(Nc3cc(-c4cc(F)cc(N)c4F)cn(C)c3=O)nc2)CC1 |
| InChI | InChI=1S/C22H24F2N6O/c1-28-5-7-30(8-6-28)16-3-4-20(26-12-16)27-19-9-14(13-29(2)22(19)31)17-10-15(23)11-18(25)21(17)24/h3-4,9-13H,5-8,25H2,1-2H3,(H,26,27) |
| InChIKey | NCVOKOFOQQQDTM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|