C23H15Cl2N5O2S — CID 6890201
1-[(E)-(3-chlorophenyl)methylideneamino]-3-(3-chlorophenyl)sulfonylpyrrolo[3,2-b]quinoxalin-2-amine (PubChem CID 6890201) has the molecular formula C23H15Cl2N5O2S and a molecular weight of 496.38 g/mol. Its IUPAC name is 1-[(E)-(3-chlorophenyl)methylideneamino]-3-(3-chlorophenyl)sulfonylpyrrolo[3,2-b]quinoxalin-2-amine.
| Compound Name | 1-[(E)-(3-chlorophenyl)methylideneamino]-3-(3-chlorophenyl)sulfonylpyrrolo[3,2-b]quinoxalin-2-amine |
|---|---|
| PubChem CID | 6890201 |
| Molecular Formula | C23H15Cl2N5O2S |
| Molecular Weight | 496.38 g/mol |
| Exact Mass | 495.03 |
| IUPAC Name | 1-[(E)-(3-chlorophenyl)methylideneamino]-3-(3-chlorophenyl)sulfonylpyrrolo[3,2-b]quinoxalin-2-amine |
| SMILES | Nc1c(S(=O)(=O)c2cccc(Cl)c2)c2nc3ccccc3nc2n1/N=C/c1cccc(Cl)c1 |
| InChI | InChI=1S/C23H15Cl2N5O2S/c24-15-6-3-5-14(11-15)13-27-30-22(26)21(33(31,32)17-8-4-7-16(25)12-17)20-23(30)29-19-10-2-1-9-18(19)28-20/h1-13H,26H2/b27-13+ |
| InChIKey | QGHVQOHVWQCGJJ-UVHMKAGCSA-N |
| XLogP | 5.19 |
| TPSA | 103.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.38 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|