C12H10F3NO3 — CID 68902237
2-oxo-4-(2,4,5-trifluorophenyl)piperidine-3-carboxylic acid (PubChem CID 68902237) has the molecular formula C12H10F3NO3 and a molecular weight of 273.21 g/mol. Its IUPAC name is 2-oxo-4-(2,4,5-trifluorophenyl)piperidine-3-carboxylic acid.
| Compound Name | 2-oxo-4-(2,4,5-trifluorophenyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 68902237 |
| Molecular Formula | C12H10F3NO3 |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 2-oxo-4-(2,4,5-trifluorophenyl)piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1C(=O)NCCC1c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C12H10F3NO3/c13-7-4-9(15)8(14)3-6(7)5-1-2-16-11(17)10(5)12(18)19/h3-5,10H,1-2H2,(H,16,17)(H,18,19) |
| InChIKey | PARIIVQLMRUONR-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|