2-oxo-4-(2,4,5-trifluorophenyl)piperidine-3-carboxylic acid

C12H10F3NO3 — CID 68902237

IUPAC2-oxo-4-(2,4,5-trifluorophenyl)piperidine-3-carboxylic acid
SMILESO=C(O)C1C(=O)NCCC1c1cc(F)c(F)cc1F
InChIInChI=1S/C12H10F3NO3/c13-7-4-9(15)8(14)3-6(7)5-1-2-16-11(17)10(5)12(18)19/h3-5,10H,1-2H2,(H,16,17)(H,18,19)
InChIKeyPARIIVQLMRUONR-UHFFFAOYSA-N
MW273.21 g/mol
LogP1.41
Rot. Bonds2

About 2-oxo-4-(2,4,5-trifluorophenyl)piperidine-3-carboxylic acid

2-oxo-4-(2,4,5-trifluorophenyl)piperidine-3-carboxylic acid (PubChem CID 68902237) has the molecular formula C12H10F3NO3 and a molecular weight of 273.21 g/mol. Its IUPAC name is 2-oxo-4-(2,4,5-trifluorophenyl)piperidine-3-carboxylic acid.

Molecular Properties

Compound Name2-oxo-4-(2,4,5-trifluorophenyl)piperidine-3-carboxylic acid
PubChem CID68902237
Molecular FormulaC12H10F3NO3
Molecular Weight273.21 g/mol
Exact Mass273.06
IUPAC Name2-oxo-4-(2,4,5-trifluorophenyl)piperidine-3-carboxylic acid
SMILESO=C(O)C1C(=O)NCCC1c1cc(F)c(F)cc1F
InChIInChI=1S/C12H10F3NO3/c13-7-4-9(15)8(14)3-6(7)5-1-2-16-11(17)10(5)12(18)19/h3-5,10H,1-2H2,(H,16,17)(H,18,19)
InChIKeyPARIIVQLMRUONR-UHFFFAOYSA-N
XLogP1.41
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500273.21
LogP ≤ 51.41
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}

Analyze 2-oxo-4-(2,4,5-trifluorophenyl)piperidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-oxo-4-(2,4,5-trifluorophenyl)piperidine-3-carboxylic acid?
The IUPAC name of 2-oxo-4-(2,4,5-trifluorophenyl)piperidine-3-carboxylic acid (CID 68902237) is 2-oxo-4-(2,4,5-trifluorophenyl)piperidine-3-carboxylic acid.
What is the SMILES notation for 2-oxo-4-(2,4,5-trifluorophenyl)piperidine-3-carboxylic acid?
The canonical SMILES for 2-oxo-4-(2,4,5-trifluorophenyl)piperidine-3-carboxylic acid is O=C(O)C1C(=O)NCCC1c1cc(F)c(F)cc1F.
What is the InChIKey of 2-oxo-4-(2,4,5-trifluorophenyl)piperidine-3-carboxylic acid?
The InChIKey is PARIIVQLMRUONR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F3NO3/c13-7-4-9(15)8(14)3-6(7)5-1-2-16-11(17)10(5)12(18)19/h3-5,10H,1-2H2,(H,16,17)(H,18,19).
What are the key properties of 2-oxo-4-(2,4,5-trifluorophenyl)piperidine-3-carboxylic acid?
2-oxo-4-(2,4,5-trifluorophenyl)piperidine-3-carboxylic acid has a molecular weight of 273.21 g/mol, XLogP of 1.41, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-4-(2,4,5-trifluorophenyl)piperidine-3-carboxylic acid is sourced from PubChem (CID 68902237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).