About 1-(2,4,4-trimethylpentyl)pyridin-2-one
1-(2,4,4-trimethylpentyl)pyridin-2-one (PubChem CID 68902534) has the molecular formula C13H21NO
and a molecular weight of 207.32 g/mol. Its IUPAC name is 1-(2,4,4-trimethylpentyl)pyridin-2-one.
Molecular Properties
| Compound Name | 1-(2,4,4-trimethylpentyl)pyridin-2-one |
| PubChem CID | 68902534 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 1-(2,4,4-trimethylpentyl)pyridin-2-one |
| SMILES | CC(Cn1ccccc1=O)CC(C)(C)C |
| InChI | InChI=1S/C13H21NO/c1-11(9-13(2,3)4)10-14-8-6-5-7-12(14)15/h5-8,11H,9-10H2,1-4H3 |
| InChIKey | NNGAOWIGWWRQIJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2,4,4-trimethylpentyl)pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4,4-trimethylpentyl)pyridin-2-one?
The IUPAC name of 1-(2,4,4-trimethylpentyl)pyridin-2-one (CID 68902534) is 1-(2,4,4-trimethylpentyl)pyridin-2-one.
What is the SMILES notation for 1-(2,4,4-trimethylpentyl)pyridin-2-one?
The canonical SMILES for 1-(2,4,4-trimethylpentyl)pyridin-2-one is CC(Cn1ccccc1=O)CC(C)(C)C.
What is the InChIKey of 1-(2,4,4-trimethylpentyl)pyridin-2-one?
The InChIKey is NNGAOWIGWWRQIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO/c1-11(9-13(2,3)4)10-14-8-6-5-7-12(14)15/h5-8,11H,9-10H2,1-4H3.
What are the key properties of 1-(2,4,4-trimethylpentyl)pyridin-2-one?
1-(2,4,4-trimethylpentyl)pyridin-2-one has a molecular weight of 207.32 g/mol, XLogP of 2.92, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4,4-trimethylpentyl)pyridin-2-one is sourced from PubChem (CID 68902534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).