About N-(cyclohexylmethyl)-N,2-dimethylprop-2-enamide
N-(cyclohexylmethyl)-N,2-dimethylprop-2-enamide (PubChem CID 68902703) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-N,2-dimethylprop-2-enamide.
Molecular Properties
| Compound Name | N-(cyclohexylmethyl)-N,2-dimethylprop-2-enamide |
| PubChem CID | 68902703 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | N-(cyclohexylmethyl)-N,2-dimethylprop-2-enamide |
| SMILES | C=C(C)C(=O)N(C)CC1CCCCC1 |
| InChI | InChI=1S/C12H21NO/c1-10(2)12(14)13(3)9-11-7-5-4-6-8-11/h11H,1,4-9H2,2-3H3 |
| InChIKey | QXPDTLQSZMKKKG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-(cyclohexylmethyl)-N,2-dimethylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclohexylmethyl)-N,2-dimethylprop-2-enamide?
The IUPAC name of N-(cyclohexylmethyl)-N,2-dimethylprop-2-enamide (CID 68902703) is N-(cyclohexylmethyl)-N,2-dimethylprop-2-enamide.
What is the SMILES notation for N-(cyclohexylmethyl)-N,2-dimethylprop-2-enamide?
The canonical SMILES for N-(cyclohexylmethyl)-N,2-dimethylprop-2-enamide is C=C(C)C(=O)N(C)CC1CCCCC1.
What is the InChIKey of N-(cyclohexylmethyl)-N,2-dimethylprop-2-enamide?
The InChIKey is QXPDTLQSZMKKKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO/c1-10(2)12(14)13(3)9-11-7-5-4-6-8-11/h11H,1,4-9H2,2-3H3.
What are the key properties of N-(cyclohexylmethyl)-N,2-dimethylprop-2-enamide?
N-(cyclohexylmethyl)-N,2-dimethylprop-2-enamide has a molecular weight of 195.31 g/mol, XLogP of 2.60, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclohexylmethyl)-N,2-dimethylprop-2-enamide is sourced from PubChem (CID 68902703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).