About 2-(4-ethenyl-4-ethoxycyclohexa-1,5-dien-1-yl)oxy-N,N-diethylethanamine
2-(4-ethenyl-4-ethoxycyclohexa-1,5-dien-1-yl)oxy-N,N-diethylethanamine (PubChem CID 68902982) has the molecular formula C16H27NO2
and a molecular weight of 265.40 g/mol. Its IUPAC name is 2-(4-ethenyl-4-ethoxycyclohexa-1,5-dien-1-yl)oxy-N,N-diethylethanamine.
Molecular Properties
| Compound Name | 2-(4-ethenyl-4-ethoxycyclohexa-1,5-dien-1-yl)oxy-N,N-diethylethanamine |
| PubChem CID | 68902982 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | 2-(4-ethenyl-4-ethoxycyclohexa-1,5-dien-1-yl)oxy-N,N-diethylethanamine |
| SMILES | C=CC1(OCC)C=CC(OCCN(CC)CC)=CC1 |
| InChI | InChI=1S/C16H27NO2/c1-5-16(19-8-4)11-9-15(10-12-16)18-14-13-17(6-2)7-3/h5,9-11H,1,6-8,12-14H2,2-4H3 |
| InChIKey | QJQFSQVQWNMDIB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-ethenyl-4-ethoxycyclohexa-1,5-dien-1-yl)oxy-N,N-diethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethenyl-4-ethoxycyclohexa-1,5-dien-1-yl)oxy-N,N-diethylethanamine?
The IUPAC name of 2-(4-ethenyl-4-ethoxycyclohexa-1,5-dien-1-yl)oxy-N,N-diethylethanamine (CID 68902982) is 2-(4-ethenyl-4-ethoxycyclohexa-1,5-dien-1-yl)oxy-N,N-diethylethanamine.
What is the SMILES notation for 2-(4-ethenyl-4-ethoxycyclohexa-1,5-dien-1-yl)oxy-N,N-diethylethanamine?
The canonical SMILES for 2-(4-ethenyl-4-ethoxycyclohexa-1,5-dien-1-yl)oxy-N,N-diethylethanamine is C=CC1(OCC)C=CC(OCCN(CC)CC)=CC1.
What is the InChIKey of 2-(4-ethenyl-4-ethoxycyclohexa-1,5-dien-1-yl)oxy-N,N-diethylethanamine?
The InChIKey is QJQFSQVQWNMDIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27NO2/c1-5-16(19-8-4)11-9-15(10-12-16)18-14-13-17(6-2)7-3/h5,9-11H,1,6-8,12-14H2,2-4H3.
What are the key properties of 2-(4-ethenyl-4-ethoxycyclohexa-1,5-dien-1-yl)oxy-N,N-diethylethanamine?
2-(4-ethenyl-4-ethoxycyclohexa-1,5-dien-1-yl)oxy-N,N-diethylethanamine has a molecular weight of 265.40 g/mol, XLogP of 3.15, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethenyl-4-ethoxycyclohexa-1,5-dien-1-yl)oxy-N,N-diethylethanamine is sourced from PubChem (CID 68902982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).