About 1-[(2S)-2,3-dihydroxy-1-phenylpropyl]-4-fluoro-3,3-dimethylindol-2-one
1-[(2S)-2,3-dihydroxy-1-phenylpropyl]-4-fluoro-3,3-dimethylindol-2-one (PubChem CID 68903023) has the molecular formula C19H20FNO3
and a molecular weight of 329.37 g/mol. Its IUPAC name is 1-[(2S)-2,3-dihydroxy-1-phenylpropyl]-4-fluoro-3,3-dimethylindol-2-one.
Molecular Properties
| Compound Name | 1-[(2S)-2,3-dihydroxy-1-phenylpropyl]-4-fluoro-3,3-dimethylindol-2-one |
| PubChem CID | 68903023 |
| Molecular Formula | C19H20FNO3 |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 1-[(2S)-2,3-dihydroxy-1-phenylpropyl]-4-fluoro-3,3-dimethylindol-2-one |
| SMILES | CC1(C)C(=O)N(C(c2ccccc2)[C@H](O)CO)c2cccc(F)c21 |
| InChI | InChI=1S/C19H20FNO3/c1-19(2)16-13(20)9-6-10-14(16)21(18(19)24)17(15(23)11-22)12-7-4-3-5-8-12/h3-10,15,17,22-23H,11H2,1-2H3/t15-,17?/m1/s1 |
| InChIKey | YCJIOSMFUDHPTM-LDCVWXEPSA-N |
| XLogP | 2.54 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(2S)-2,3-dihydroxy-1-phenylpropyl]-4-fluoro-3,3-dimethylindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S)-2,3-dihydroxy-1-phenylpropyl]-4-fluoro-3,3-dimethylindol-2-one?
The IUPAC name of 1-[(2S)-2,3-dihydroxy-1-phenylpropyl]-4-fluoro-3,3-dimethylindol-2-one (CID 68903023) is 1-[(2S)-2,3-dihydroxy-1-phenylpropyl]-4-fluoro-3,3-dimethylindol-2-one.
What is the SMILES notation for 1-[(2S)-2,3-dihydroxy-1-phenylpropyl]-4-fluoro-3,3-dimethylindol-2-one?
The canonical SMILES for 1-[(2S)-2,3-dihydroxy-1-phenylpropyl]-4-fluoro-3,3-dimethylindol-2-one is CC1(C)C(=O)N(C(c2ccccc2)[C@H](O)CO)c2cccc(F)c21.
What is the InChIKey of 1-[(2S)-2,3-dihydroxy-1-phenylpropyl]-4-fluoro-3,3-dimethylindol-2-one?
The InChIKey is YCJIOSMFUDHPTM-LDCVWXEPSA-N. The full InChI is InChI=1S/C19H20FNO3/c1-19(2)16-13(20)9-6-10-14(16)21(18(19)24)17(15(23)11-22)12-7-4-3-5-8-12/h3-10,15,17,22-23H,11H2,1-2H3/t15-,17?/m1/s1.
What are the key properties of 1-[(2S)-2,3-dihydroxy-1-phenylpropyl]-4-fluoro-3,3-dimethylindol-2-one?
1-[(2S)-2,3-dihydroxy-1-phenylpropyl]-4-fluoro-3,3-dimethylindol-2-one has a molecular weight of 329.37 g/mol, XLogP of 2.54, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S)-2,3-dihydroxy-1-phenylpropyl]-4-fluoro-3,3-dimethylindol-2-one is sourced from PubChem (CID 68903023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).