About 7,8-dihydro-5H-[1,2,4]triazolo[1,5-c][1,3]oxazine
7,8-dihydro-5H-[1,2,4]triazolo[1,5-c][1,3]oxazine (PubChem CID 68903331) has the molecular formula C5H7N3O
and a molecular weight of 125.13 g/mol. Its IUPAC name is 7,8-dihydro-5H-[1,2,4]triazolo[1,5-c][1,3]oxazine.
Analyze 7,8-dihydro-5H-[1,2,4]triazolo[1,5-c][1,3]oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dihydro-5H-[1,2,4]triazolo[1,5-c][1,3]oxazine?
The IUPAC name of 7,8-dihydro-5H-[1,2,4]triazolo[1,5-c][1,3]oxazine (CID 68903331) is 7,8-dihydro-5H-[1,2,4]triazolo[1,5-c][1,3]oxazine.
What is the SMILES notation for 7,8-dihydro-5H-[1,2,4]triazolo[1,5-c][1,3]oxazine?
The canonical SMILES for 7,8-dihydro-5H-[1,2,4]triazolo[1,5-c][1,3]oxazine is c1nc2n(n1)COCC2.
What is the InChIKey of 7,8-dihydro-5H-[1,2,4]triazolo[1,5-c][1,3]oxazine?
The InChIKey is JSGNSEZAYUUUDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3O/c1-2-9-4-8-5(1)6-3-7-8/h3H,1-2,4H2.
What are the key properties of 7,8-dihydro-5H-[1,2,4]triazolo[1,5-c][1,3]oxazine?
7,8-dihydro-5H-[1,2,4]triazolo[1,5-c][1,3]oxazine has a molecular weight of 125.13 g/mol, XLogP of -0.19, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dihydro-5H-[1,2,4]triazolo[1,5-c][1,3]oxazine is sourced from PubChem (CID 68903331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).