C17H22FN5 — CID 68903360
5-(3-fluorophenyl)-4-N-(3-pyrrolidin-1-ylpropyl)pyrimidine-2,4-diamine (PubChem CID 68903360) has the molecular formula C17H22FN5 and a molecular weight of 315.40 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-4-N-(3-pyrrolidin-1-ylpropyl)pyrimidine-2,4-diamine.
| Compound Name | 5-(3-fluorophenyl)-4-N-(3-pyrrolidin-1-ylpropyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 68903360 |
| Molecular Formula | C17H22FN5 |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 5-(3-fluorophenyl)-4-N-(3-pyrrolidin-1-ylpropyl)pyrimidine-2,4-diamine |
| SMILES | Nc1ncc(-c2cccc(F)c2)c(NCCCN2CCCC2)n1 |
| InChI | InChI=1S/C17H22FN5/c18-14-6-3-5-13(11-14)15-12-21-17(19)22-16(15)20-7-4-10-23-8-1-2-9-23/h3,5-6,11-12H,1-2,4,7-10H2,(H3,19,20,21,22) |
| InChIKey | CGKSIFNGXQKVAV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|