C26H32Cl2N2O4Si — CID 68903416
(4S,5R,6S)-6'-chloro-6-(3-chlorophenyl)-4-methoxy-1'-(2-trimethylsilylethoxymethyl)spiro[azepane-5,3'-indole]-2,2'-dione (PubChem CID 68903416) has the molecular formula C26H32Cl2N2O4Si and a molecular weight of 535.54 g/mol. Its IUPAC name is (4S,5R,6S)-6'-chloro-6-(3-chlorophenyl)-4-methoxy-1'-(2-trimethylsilylethoxymethyl)spiro[azepane-5,3'-indole]-2,2'-dione.
| Compound Name | (4S,5R,6S)-6'-chloro-6-(3-chlorophenyl)-4-methoxy-1'-(2-trimethylsilylethoxymethyl)spiro[azepane-5,3'-indole]-2,2'-dione |
|---|---|
| PubChem CID | 68903416 |
| Molecular Formula | C26H32Cl2N2O4Si |
| Molecular Weight | 535.54 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | (4S,5R,6S)-6'-chloro-6-(3-chlorophenyl)-4-methoxy-1'-(2-trimethylsilylethoxymethyl)spiro[azepane-5,3'-indole]-2,2'-dione |
| SMILES | CO[C@H]1CC(=O)NC[C@@H](c2cccc(Cl)c2)[C@]12C(=O)N(COCC[Si](C)(C)C)c1cc(Cl)ccc12 |
| InChI | InChI=1S/C26H32Cl2N2O4Si/c1-33-23-14-24(31)29-15-21(17-6-5-7-18(27)12-17)26(23)20-9-8-19(28)13-22(20)30(25(26)32)16-34-10-11-35(2,3)4/h5-9,12-13,21,23H,10-11,14-16H2,1-4H3,(H,29,31)/t21-,23-,26-/m0/s1 |
| InChIKey | PSHMVSKRVAOPCQ-KJOQGJGQSA-N |
| XLogP | 5.21 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.54 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|