C23H27N3O4S — CID 68904020
N-(3-methoxypropyl)-4-methyl-N-(quinolin-3-ylmethyl)-2,3-dihydro-1,4-benzoxazine-7-sulfonamide (PubChem CID 68904020) has the molecular formula C23H27N3O4S and a molecular weight of 441.55 g/mol. Its IUPAC name is N-(3-methoxypropyl)-4-methyl-N-(quinolin-3-ylmethyl)-2,3-dihydro-1,4-benzoxazine-7-sulfonamide.
| Compound Name | N-(3-methoxypropyl)-4-methyl-N-(quinolin-3-ylmethyl)-2,3-dihydro-1,4-benzoxazine-7-sulfonamide |
|---|---|
| PubChem CID | 68904020 |
| Molecular Formula | C23H27N3O4S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | N-(3-methoxypropyl)-4-methyl-N-(quinolin-3-ylmethyl)-2,3-dihydro-1,4-benzoxazine-7-sulfonamide |
| SMILES | COCCCN(Cc1cnc2ccccc2c1)S(=O)(=O)c1ccc2c(c1)OCCN2C |
| InChI | InChI=1S/C23H27N3O4S/c1-25-11-13-30-23-15-20(8-9-22(23)25)31(27,28)26(10-5-12-29-2)17-18-14-19-6-3-4-7-21(19)24-16-18/h3-4,6-9,14-16H,5,10-13,17H2,1-2H3 |
| InChIKey | UBHSQIXADZIDLO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|