About 7-fluoro-1-[(1S,2S)-2-hydroxy-3-(methylamino)-1-phenylpropyl]-3,3-dimethylindol-2-one
7-fluoro-1-[(1S,2S)-2-hydroxy-3-(methylamino)-1-phenylpropyl]-3,3-dimethylindol-2-one (PubChem CID 68904155) has the molecular formula C20H23FN2O2
and a molecular weight of 342.41 g/mol. Its IUPAC name is 7-fluoro-1-[(1S,2S)-2-hydroxy-3-(methylamino)-1-phenylpropyl]-3,3-dimethylindol-2-one.
Molecular Properties
| Compound Name | 7-fluoro-1-[(1S,2S)-2-hydroxy-3-(methylamino)-1-phenylpropyl]-3,3-dimethylindol-2-one |
| PubChem CID | 68904155 |
| Molecular Formula | C20H23FN2O2 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 7-fluoro-1-[(1S,2S)-2-hydroxy-3-(methylamino)-1-phenylpropyl]-3,3-dimethylindol-2-one |
| SMILES | CNC[C@H](O)[C@H](c1ccccc1)N1C(=O)C(C)(C)c2cccc(F)c21 |
| InChI | InChI=1S/C20H23FN2O2/c1-20(2)14-10-7-11-15(21)18(14)23(19(20)25)17(16(24)12-22-3)13-8-5-4-6-9-13/h4-11,16-17,22,24H,12H2,1-3H3/t16-,17-/m0/s1 |
| InChIKey | DADFMLWKOVZVKM-IRXDYDNUSA-N |
| XLogP | 2.77 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-fluoro-1-[(1S,2S)-2-hydroxy-3-(methylamino)-1-phenylpropyl]-3,3-dimethylindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-1-[(1S,2S)-2-hydroxy-3-(methylamino)-1-phenylpropyl]-3,3-dimethylindol-2-one?
The IUPAC name of 7-fluoro-1-[(1S,2S)-2-hydroxy-3-(methylamino)-1-phenylpropyl]-3,3-dimethylindol-2-one (CID 68904155) is 7-fluoro-1-[(1S,2S)-2-hydroxy-3-(methylamino)-1-phenylpropyl]-3,3-dimethylindol-2-one.
What is the SMILES notation for 7-fluoro-1-[(1S,2S)-2-hydroxy-3-(methylamino)-1-phenylpropyl]-3,3-dimethylindol-2-one?
The canonical SMILES for 7-fluoro-1-[(1S,2S)-2-hydroxy-3-(methylamino)-1-phenylpropyl]-3,3-dimethylindol-2-one is CNC[C@H](O)[C@H](c1ccccc1)N1C(=O)C(C)(C)c2cccc(F)c21.
What is the InChIKey of 7-fluoro-1-[(1S,2S)-2-hydroxy-3-(methylamino)-1-phenylpropyl]-3,3-dimethylindol-2-one?
The InChIKey is DADFMLWKOVZVKM-IRXDYDNUSA-N. The full InChI is InChI=1S/C20H23FN2O2/c1-20(2)14-10-7-11-15(21)18(14)23(19(20)25)17(16(24)12-22-3)13-8-5-4-6-9-13/h4-11,16-17,22,24H,12H2,1-3H3/t16-,17-/m0/s1.
What are the key properties of 7-fluoro-1-[(1S,2S)-2-hydroxy-3-(methylamino)-1-phenylpropyl]-3,3-dimethylindol-2-one?
7-fluoro-1-[(1S,2S)-2-hydroxy-3-(methylamino)-1-phenylpropyl]-3,3-dimethylindol-2-one has a molecular weight of 342.41 g/mol, XLogP of 2.77, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-1-[(1S,2S)-2-hydroxy-3-(methylamino)-1-phenylpropyl]-3,3-dimethylindol-2-one is sourced from PubChem (CID 68904155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).