About ethyl 4-(2,4-difluoroanilino)-7-methoxy-6-piperidin-4-ylquinoline-3-carboxylate
ethyl 4-(2,4-difluoroanilino)-7-methoxy-6-piperidin-4-ylquinoline-3-carboxylate (PubChem CID 68904448) has the molecular formula C24H25F2N3O3
and a molecular weight of 441.48 g/mol. Its IUPAC name is ethyl 4-(2,4-difluoroanilino)-7-methoxy-6-piperidin-4-ylquinoline-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-(2,4-difluoroanilino)-7-methoxy-6-piperidin-4-ylquinoline-3-carboxylate |
| PubChem CID | 68904448 |
| Molecular Formula | C24H25F2N3O3 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | ethyl 4-(2,4-difluoroanilino)-7-methoxy-6-piperidin-4-ylquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2cc(OC)c(C3CCNCC3)cc2c1Nc1ccc(F)cc1F |
| InChI | InChI=1S/C24H25F2N3O3/c1-3-32-24(30)18-13-28-21-12-22(31-2)16(14-6-8-27-9-7-14)11-17(21)23(18)29-20-5-4-15(25)10-19(20)26/h4-5,10-14,27H,3,6-9H2,1-2H3,(H,28,29) |
| InChIKey | YSORHSWWNAIPAJ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 4-(2,4-difluoroanilino)-7-methoxy-6-piperidin-4-ylquinoline-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(2,4-difluoroanilino)-7-methoxy-6-piperidin-4-ylquinoline-3-carboxylate?
The IUPAC name of ethyl 4-(2,4-difluoroanilino)-7-methoxy-6-piperidin-4-ylquinoline-3-carboxylate (CID 68904448) is ethyl 4-(2,4-difluoroanilino)-7-methoxy-6-piperidin-4-ylquinoline-3-carboxylate.
What is the SMILES notation for ethyl 4-(2,4-difluoroanilino)-7-methoxy-6-piperidin-4-ylquinoline-3-carboxylate?
The canonical SMILES for ethyl 4-(2,4-difluoroanilino)-7-methoxy-6-piperidin-4-ylquinoline-3-carboxylate is CCOC(=O)c1cnc2cc(OC)c(C3CCNCC3)cc2c1Nc1ccc(F)cc1F.
What is the InChIKey of ethyl 4-(2,4-difluoroanilino)-7-methoxy-6-piperidin-4-ylquinoline-3-carboxylate?
The InChIKey is YSORHSWWNAIPAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25F2N3O3/c1-3-32-24(30)18-13-28-21-12-22(31-2)16(14-6-8-27-9-7-14)11-17(21)23(18)29-20-5-4-15(25)10-19(20)26/h4-5,10-14,27H,3,6-9H2,1-2H3,(H,28,29).
What are the key properties of ethyl 4-(2,4-difluoroanilino)-7-methoxy-6-piperidin-4-ylquinoline-3-carboxylate?
ethyl 4-(2,4-difluoroanilino)-7-methoxy-6-piperidin-4-ylquinoline-3-carboxylate has a molecular weight of 441.48 g/mol, XLogP of 4.91, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(2,4-difluoroanilino)-7-methoxy-6-piperidin-4-ylquinoline-3-carboxylate is sourced from PubChem (CID 68904448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).