C26H27N3O5S — CID 68904786
N-(3-methoxypropyl)-N-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]-6-phenoxypyridine-3-sulfonamide (PubChem CID 68904786) has the molecular formula C26H27N3O5S and a molecular weight of 493.59 g/mol. Its IUPAC name is N-(3-methoxypropyl)-N-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]-6-phenoxypyridine-3-sulfonamide.
| Compound Name | N-(3-methoxypropyl)-N-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]-6-phenoxypyridine-3-sulfonamide |
|---|---|
| PubChem CID | 68904786 |
| Molecular Formula | C26H27N3O5S |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | N-(3-methoxypropyl)-N-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]-6-phenoxypyridine-3-sulfonamide |
| SMILES | COCCCN(Cc1cc2cccc(C)c2[nH]c1=O)S(=O)(=O)c1ccc(Oc2ccccc2)nc1 |
| InChI | InChI=1S/C26H27N3O5S/c1-19-8-6-9-20-16-21(26(30)28-25(19)20)18-29(14-7-15-33-2)35(31,32)23-12-13-24(27-17-23)34-22-10-4-3-5-11-22/h3-6,8-13,16-17H,7,14-15,18H2,1-2H3,(H,28,30) |
| InChIKey | ASZBRGYYXNPBJY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 101.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|