About (2S,3S)-3-(5-chloro-3-methylindol-1-yl)-3-phenylpropane-1,2-diol
(2S,3S)-3-(5-chloro-3-methylindol-1-yl)-3-phenylpropane-1,2-diol (PubChem CID 68904807) has the molecular formula C18H18ClNO2
and a molecular weight of 315.80 g/mol. Its IUPAC name is (2S,3S)-3-(5-chloro-3-methylindol-1-yl)-3-phenylpropane-1,2-diol.
Molecular Properties
| Compound Name | (2S,3S)-3-(5-chloro-3-methylindol-1-yl)-3-phenylpropane-1,2-diol |
| PubChem CID | 68904807 |
| Molecular Formula | C18H18ClNO2 |
| Molecular Weight | 315.80 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | (2S,3S)-3-(5-chloro-3-methylindol-1-yl)-3-phenylpropane-1,2-diol |
| SMILES | Cc1cn([C@@H](c2ccccc2)[C@H](O)CO)c2ccc(Cl)cc12 |
| InChI | InChI=1S/C18H18ClNO2/c1-12-10-20(16-8-7-14(19)9-15(12)16)18(17(22)11-21)13-5-3-2-4-6-13/h2-10,17-18,21-22H,11H2,1H3/t17-,18+/m1/s1 |
| InChIKey | DOYITYXTLFGWBO-MSOLQXFVSA-N |
| XLogP | 3.55 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.80 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S,3S)-3-(5-chloro-3-methylindol-1-yl)-3-phenylpropane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-3-(5-chloro-3-methylindol-1-yl)-3-phenylpropane-1,2-diol?
The IUPAC name of (2S,3S)-3-(5-chloro-3-methylindol-1-yl)-3-phenylpropane-1,2-diol (CID 68904807) is (2S,3S)-3-(5-chloro-3-methylindol-1-yl)-3-phenylpropane-1,2-diol.
What is the SMILES notation for (2S,3S)-3-(5-chloro-3-methylindol-1-yl)-3-phenylpropane-1,2-diol?
The canonical SMILES for (2S,3S)-3-(5-chloro-3-methylindol-1-yl)-3-phenylpropane-1,2-diol is Cc1cn([C@@H](c2ccccc2)[C@H](O)CO)c2ccc(Cl)cc12.
What is the InChIKey of (2S,3S)-3-(5-chloro-3-methylindol-1-yl)-3-phenylpropane-1,2-diol?
The InChIKey is DOYITYXTLFGWBO-MSOLQXFVSA-N. The full InChI is InChI=1S/C18H18ClNO2/c1-12-10-20(16-8-7-14(19)9-15(12)16)18(17(22)11-21)13-5-3-2-4-6-13/h2-10,17-18,21-22H,11H2,1H3/t17-,18+/m1/s1.
What are the key properties of (2S,3S)-3-(5-chloro-3-methylindol-1-yl)-3-phenylpropane-1,2-diol?
(2S,3S)-3-(5-chloro-3-methylindol-1-yl)-3-phenylpropane-1,2-diol has a molecular weight of 315.80 g/mol, XLogP of 3.55, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-3-(5-chloro-3-methylindol-1-yl)-3-phenylpropane-1,2-diol is sourced from PubChem (CID 68904807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).