C24H29F3N4O3 — CID 68905135
[4-[N-cyclopropyl-4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]anilino]-1-pyrimidin-2-ylcyclohexyl]methyl carbamate (PubChem CID 68905135) has the molecular formula C24H29F3N4O3 and a molecular weight of 478.52 g/mol. Its IUPAC name is [4-[N-cyclopropyl-4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]anilino]-1-pyrimidin-2-ylcyclohexyl]methyl carbamate.
| Compound Name | [4-[N-cyclopropyl-4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]anilino]-1-pyrimidin-2-ylcyclohexyl]methyl carbamate |
|---|---|
| PubChem CID | 68905135 |
| Molecular Formula | C24H29F3N4O3 |
| Molecular Weight | 478.52 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | [4-[N-cyclopropyl-4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]anilino]-1-pyrimidin-2-ylcyclohexyl]methyl carbamate |
| SMILES | C[C@](O)(c1ccc(N(C2CC2)C2CCC(COC(N)=O)(c3ncccn3)CC2)cc1)C(F)(F)F |
| InChI | InChI=1S/C24H29F3N4O3/c1-22(33,24(25,26)27)16-3-5-17(6-4-16)31(18-7-8-18)19-9-11-23(12-10-19,15-34-21(28)32)20-29-13-2-14-30-20/h2-6,13-14,18-19,33H,7-12,15H2,1H3,(H2,28,32)/t19?,22-,23?/m0/s1 |
| InChIKey | FSAKCLJVXCWKHZ-UTCTYZAISA-N |
| XLogP | 4.19 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.52 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|