C46H50Cl2FN7O2 — CID 68905150
1,2-bis[1-[(4-chloro-3-ethoxyphenyl)methyl]piperidin-4-yl]-1-(6-fluoroquinolin-2-yl)-2-(5-methyl-1,6-naphthyridin-2-yl)hydrazine (PubChem CID 68905150) has the molecular formula C46H50Cl2FN7O2 and a molecular weight of 822.86 g/mol. Its IUPAC name is 1,2-bis[1-[(4-chloro-3-ethoxyphenyl)methyl]piperidin-4-yl]-1-(6-fluoroquinolin-2-yl)-2-(5-methyl-1,6-naphthyridin-2-yl)hydrazine.
| Compound Name | 1,2-bis[1-[(4-chloro-3-ethoxyphenyl)methyl]piperidin-4-yl]-1-(6-fluoroquinolin-2-yl)-2-(5-methyl-1,6-naphthyridin-2-yl)hydrazine |
|---|---|
| PubChem CID | 68905150 |
| Molecular Formula | C46H50Cl2FN7O2 |
| Molecular Weight | 822.86 g/mol |
| Exact Mass | 821.34 |
| IUPAC Name | 1,2-bis[1-[(4-chloro-3-ethoxyphenyl)methyl]piperidin-4-yl]-1-(6-fluoroquinolin-2-yl)-2-(5-methyl-1,6-naphthyridin-2-yl)hydrazine |
| SMILES | CCOc1cc(CN2CCC(N(c3ccc4cc(F)ccc4n3)N(c3ccc4c(C)nccc4n3)C3CCN(Cc4ccc(Cl)c(OCC)c4)CC3)CC2)ccc1Cl |
| InChI | InChI=1S/C46H50Cl2FN7O2/c1-4-57-43-26-32(6-11-39(43)47)29-53-22-17-36(18-23-53)55(45-14-8-34-28-35(49)9-13-41(34)51-45)56(46-15-10-38-31(3)50-21-16-42(38)52-46)37-19-24-54(25-20-37)30-33-7-12-40(48)44(27-33)58-5-2/h6-16,21,26-28,36-37H,4-5,17-20,22-25,29-30H2,1-3H3 |
| InChIKey | SWGVCLAZJYERAC-UHFFFAOYSA-N |
| XLogP | 10.29 |
| TPSA | 70.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.86 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|