C10H17N3S — CID 68905391
6-N-prop-2-enyl-2,3,4,5,6,7-hexahydro-1,3-benzothiazole-2,6-diamine (PubChem CID 68905391) has the molecular formula C10H17N3S and a molecular weight of 211.33 g/mol. Its IUPAC name is 6-N-prop-2-enyl-2,3,4,5,6,7-hexahydro-1,3-benzothiazole-2,6-diamine.
| Compound Name | 6-N-prop-2-enyl-2,3,4,5,6,7-hexahydro-1,3-benzothiazole-2,6-diamine |
|---|---|
| PubChem CID | 68905391 |
| Molecular Formula | C10H17N3S |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 6-N-prop-2-enyl-2,3,4,5,6,7-hexahydro-1,3-benzothiazole-2,6-diamine |
| SMILES | C=CCNC1CCC2=C(C1)SC(N)N2 |
| InChI | InChI=1S/C10H17N3S/c1-2-5-12-7-3-4-8-9(6-7)14-10(11)13-8/h2,7,10,12-13H,1,3-6,11H2 |
| InChIKey | WXXRAXBFGKPQCP-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|