C26H26ClFN2OS — CID 68905472
(4S)-1-[4-[2-(chloromethoxy)phenyl]-5-methyl-1,3-thiazol-2-yl]-5-cyclopropyl-4-(3-fluoro-4-methylphenyl)pent-2-yn-1-amine (PubChem CID 68905472) has the molecular formula C26H26ClFN2OS and a molecular weight of 469.03 g/mol. Its IUPAC name is (4S)-1-[4-[2-(chloromethoxy)phenyl]-5-methyl-1,3-thiazol-2-yl]-5-cyclopropyl-4-(3-fluoro-4-methylphenyl)pent-2-yn-1-amine.
| Compound Name | (4S)-1-[4-[2-(chloromethoxy)phenyl]-5-methyl-1,3-thiazol-2-yl]-5-cyclopropyl-4-(3-fluoro-4-methylphenyl)pent-2-yn-1-amine |
|---|---|
| PubChem CID | 68905472 |
| Molecular Formula | C26H26ClFN2OS |
| Molecular Weight | 469.03 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | (4S)-1-[4-[2-(chloromethoxy)phenyl]-5-methyl-1,3-thiazol-2-yl]-5-cyclopropyl-4-(3-fluoro-4-methylphenyl)pent-2-yn-1-amine |
| SMILES | Cc1ccc([C@@H](C#CC(N)c2nc(-c3ccccc3OCCl)c(C)s2)CC2CC2)cc1F |
| InChI | InChI=1S/C26H26ClFN2OS/c1-16-7-10-20(14-22(16)28)19(13-18-8-9-18)11-12-23(29)26-30-25(17(2)32-26)21-5-3-4-6-24(21)31-15-27/h3-7,10,14,18-19,23H,8-9,13,15,29H2,1-2H3/t19-,23?/m0/s1 |
| InChIKey | FMESPBNBMLKMCC-HSTJUUNISA-N |
| XLogP | 6.73 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.03 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|