C25H30N2O2 — CID 68905775
N-[(5R)-3-benzyl-3-azabicyclo[3.1.0]hexan-6-yl]-2-cyclopentyl-2-hydroxy-2-phenylacetamide (PubChem CID 68905775) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is N-[(5R)-3-benzyl-3-azabicyclo[3.1.0]hexan-6-yl]-2-cyclopentyl-2-hydroxy-2-phenylacetamide.
| Compound Name | N-[(5R)-3-benzyl-3-azabicyclo[3.1.0]hexan-6-yl]-2-cyclopentyl-2-hydroxy-2-phenylacetamide |
|---|---|
| PubChem CID | 68905775 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | N-[(5R)-3-benzyl-3-azabicyclo[3.1.0]hexan-6-yl]-2-cyclopentyl-2-hydroxy-2-phenylacetamide |
| SMILES | O=C(NC1C2CN(Cc3ccccc3)C[C@@H]21)C(O)(c1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C25H30N2O2/c28-24(25(29,20-13-7-8-14-20)19-11-5-2-6-12-19)26-23-21-16-27(17-22(21)23)15-18-9-3-1-4-10-18/h1-6,9-12,20-23,29H,7-8,13-17H2,(H,26,28)/t21-,22?,23?,25?/m0/s1 |
| InChIKey | FABMJJIZCBJHOD-VZUXVUPXSA-N |
| XLogP | 3.31 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |