About 5-(2-bromoethyl)-2,2-diethyl-1,3-dioxane
5-(2-bromoethyl)-2,2-diethyl-1,3-dioxane (PubChem CID 68906149) has the molecular formula C10H19BrO2
and a molecular weight of 251.16 g/mol. Its IUPAC name is 5-(2-bromoethyl)-2,2-diethyl-1,3-dioxane.
Molecular Properties
| Compound Name | 5-(2-bromoethyl)-2,2-diethyl-1,3-dioxane |
| PubChem CID | 68906149 |
| Molecular Formula | C10H19BrO2 |
| Molecular Weight | 251.16 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 5-(2-bromoethyl)-2,2-diethyl-1,3-dioxane |
| SMILES | CCC1(CC)OCC(CCBr)CO1 |
| InChI | InChI=1S/C10H19BrO2/c1-3-10(4-2)12-7-9(5-6-11)8-13-10/h9H,3-8H2,1-2H3 |
| InChIKey | BTXJDFLRBYKFIB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.16 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-bromoethyl)-2,2-diethyl-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-bromoethyl)-2,2-diethyl-1,3-dioxane?
The IUPAC name of 5-(2-bromoethyl)-2,2-diethyl-1,3-dioxane (CID 68906149) is 5-(2-bromoethyl)-2,2-diethyl-1,3-dioxane.
What is the SMILES notation for 5-(2-bromoethyl)-2,2-diethyl-1,3-dioxane?
The canonical SMILES for 5-(2-bromoethyl)-2,2-diethyl-1,3-dioxane is CCC1(CC)OCC(CCBr)CO1.
What is the InChIKey of 5-(2-bromoethyl)-2,2-diethyl-1,3-dioxane?
The InChIKey is BTXJDFLRBYKFIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19BrO2/c1-3-10(4-2)12-7-9(5-6-11)8-13-10/h9H,3-8H2,1-2H3.
What are the key properties of 5-(2-bromoethyl)-2,2-diethyl-1,3-dioxane?
5-(2-bromoethyl)-2,2-diethyl-1,3-dioxane has a molecular weight of 251.16 g/mol, XLogP of 2.95, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-bromoethyl)-2,2-diethyl-1,3-dioxane is sourced from PubChem (CID 68906149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).