C26H38BNO3 — CID 68906161
2,6-dimethyl-1-[3-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]oxypropyl]piperidine (PubChem CID 68906161) has the molecular formula C26H38BNO3 and a molecular weight of 423.41 g/mol. Its IUPAC name is 2,6-dimethyl-1-[3-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]oxypropyl]piperidine.
| Compound Name | 2,6-dimethyl-1-[3-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]oxypropyl]piperidine |
|---|---|
| PubChem CID | 68906161 |
| Molecular Formula | C26H38BNO3 |
| Molecular Weight | 423.41 g/mol |
| Exact Mass | 423.29 |
| IUPAC Name | 2,6-dimethyl-1-[3-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]oxypropyl]piperidine |
| SMILES | CC1CCCC(C)N1CCCOc1ccc2cc(B3OC(C)(C)C(C)(C)O3)ccc2c1 |
| InChI | InChI=1S/C26H38BNO3/c1-19-9-7-10-20(2)28(19)15-8-16-29-24-14-12-21-17-23(13-11-22(21)18-24)27-30-25(3,4)26(5,6)31-27/h11-14,17-20H,7-10,15-16H2,1-6H3 |
| InChIKey | XJLUCIWJMUSKAQ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.41 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|