About (2S)-4-(2-methylpropyl)-2-(trifluoromethyl)-1,3-oxazolidine
(2S)-4-(2-methylpropyl)-2-(trifluoromethyl)-1,3-oxazolidine (PubChem CID 68906347) has the molecular formula C8H14F3NO
and a molecular weight of 197.20 g/mol. Its IUPAC name is (2S)-4-(2-methylpropyl)-2-(trifluoromethyl)-1,3-oxazolidine.
Molecular Properties
| Compound Name | (2S)-4-(2-methylpropyl)-2-(trifluoromethyl)-1,3-oxazolidine |
| PubChem CID | 68906347 |
| Molecular Formula | C8H14F3NO |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | (2S)-4-(2-methylpropyl)-2-(trifluoromethyl)-1,3-oxazolidine |
| SMILES | CC(C)CC1CO[C@@H](C(F)(F)F)N1 |
| InChI | InChI=1S/C8H14F3NO/c1-5(2)3-6-4-13-7(12-6)8(9,10)11/h5-7,12H,3-4H2,1-2H3/t6?,7-/m0/s1 |
| InChIKey | IYTIXZWGGKYGOR-MLWJPKLSSA-N |
| XLogP | 1.91 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-4-(2-methylpropyl)-2-(trifluoromethyl)-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4-(2-methylpropyl)-2-(trifluoromethyl)-1,3-oxazolidine?
The IUPAC name of (2S)-4-(2-methylpropyl)-2-(trifluoromethyl)-1,3-oxazolidine (CID 68906347) is (2S)-4-(2-methylpropyl)-2-(trifluoromethyl)-1,3-oxazolidine.
What is the SMILES notation for (2S)-4-(2-methylpropyl)-2-(trifluoromethyl)-1,3-oxazolidine?
The canonical SMILES for (2S)-4-(2-methylpropyl)-2-(trifluoromethyl)-1,3-oxazolidine is CC(C)CC1CO[C@@H](C(F)(F)F)N1.
What is the InChIKey of (2S)-4-(2-methylpropyl)-2-(trifluoromethyl)-1,3-oxazolidine?
The InChIKey is IYTIXZWGGKYGOR-MLWJPKLSSA-N. The full InChI is InChI=1S/C8H14F3NO/c1-5(2)3-6-4-13-7(12-6)8(9,10)11/h5-7,12H,3-4H2,1-2H3/t6?,7-/m0/s1.
What are the key properties of (2S)-4-(2-methylpropyl)-2-(trifluoromethyl)-1,3-oxazolidine?
(2S)-4-(2-methylpropyl)-2-(trifluoromethyl)-1,3-oxazolidine has a molecular weight of 197.20 g/mol, XLogP of 1.91, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-(2-methylpropyl)-2-(trifluoromethyl)-1,3-oxazolidine is sourced from PubChem (CID 68906347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).