C21H23N7 — CID 68906432
4-N-[3-(2,4-dihydroimidazol-3-yl)propyl]-5-(3-pyridin-2-ylphenyl)pyrimidine-2,4-diamine (PubChem CID 68906432) has the molecular formula C21H23N7 and a molecular weight of 373.46 g/mol. Its IUPAC name is 4-N-[3-(2,4-dihydroimidazol-3-yl)propyl]-5-(3-pyridin-2-ylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-[3-(2,4-dihydroimidazol-3-yl)propyl]-5-(3-pyridin-2-ylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 68906432 |
| Molecular Formula | C21H23N7 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 4-N-[3-(2,4-dihydroimidazol-3-yl)propyl]-5-(3-pyridin-2-ylphenyl)pyrimidine-2,4-diamine |
| SMILES | Nc1ncc(-c2cccc(-c3ccccn3)c2)c(NCCCN2CC=NC2)n1 |
| InChI | InChI=1S/C21H23N7/c22-21-26-14-18(20(27-21)25-9-4-11-28-12-10-23-15-28)16-5-3-6-17(13-16)19-7-1-2-8-24-19/h1-3,5-8,10,13-14H,4,9,11-12,15H2,(H3,22,25,26,27) |
| InChIKey | KNDFCDYPVVTEND-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|