C17H17F2NO3 — CID 68907160
(E)-3-[(2R,5S)-1-but-3-enoyl-5-(3,4-difluorophenyl)pyrrolidin-2-yl]prop-2-enoic acid (PubChem CID 68907160) has the molecular formula C17H17F2NO3 and a molecular weight of 321.32 g/mol. Its IUPAC name is (E)-3-[(2R,5S)-1-but-3-enoyl-5-(3,4-difluorophenyl)pyrrolidin-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[(2R,5S)-1-but-3-enoyl-5-(3,4-difluorophenyl)pyrrolidin-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 68907160 |
| Molecular Formula | C17H17F2NO3 |
| Molecular Weight | 321.32 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | (E)-3-[(2R,5S)-1-but-3-enoyl-5-(3,4-difluorophenyl)pyrrolidin-2-yl]prop-2-enoic acid |
| SMILES | C=CCC(=O)N1[C@@H](/C=C/C(=O)O)CC[C@H]1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H17F2NO3/c1-2-3-16(21)20-12(6-9-17(22)23)5-8-15(20)11-4-7-13(18)14(19)10-11/h2,4,6-7,9-10,12,15H,1,3,5,8H2,(H,22,23)/b9-6+/t12-,15+/m1/s1 |
| InChIKey | YHANJGANPRGIDP-FJUBQESYSA-N |
| XLogP | 3.21 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|