C13H12N6O3S — CID 68907188
5-[4-[(3-nitro-4-pyridinyl)oxy]piperidin-1-yl]-1,3,4-thiadiazole-2-carbonitrile (PubChem CID 68907188) has the molecular formula C13H12N6O3S and a molecular weight of 332.35 g/mol. Its IUPAC name is 5-[4-[(3-nitro-4-pyridinyl)oxy]piperidin-1-yl]-1,3,4-thiadiazole-2-carbonitrile.
| Compound Name | 5-[4-[(3-nitro-4-pyridinyl)oxy]piperidin-1-yl]-1,3,4-thiadiazole-2-carbonitrile |
|---|---|
| PubChem CID | 68907188 |
| Molecular Formula | C13H12N6O3S |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 5-[4-[(3-nitro-4-pyridinyl)oxy]piperidin-1-yl]-1,3,4-thiadiazole-2-carbonitrile |
| SMILES | N#Cc1nnc(N2CCC(Oc3ccncc3[N+](=O)[O-])CC2)s1 |
| InChI | InChI=1S/C13H12N6O3S/c14-7-12-16-17-13(23-12)18-5-2-9(3-6-18)22-11-1-4-15-8-10(11)19(20)21/h1,4,8-9H,2-3,5-6H2 |
| InChIKey | RRWNXVUEVYSFMQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 118.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|