C10H15ClN2O — CID 68907368
1,4,6-trimethyl-3-prop-2-enylpyrimidin-1-ium-2-one chloride (PubChem CID 68907368) has the molecular formula C10H15ClN2O and a molecular weight of 214.70 g/mol. Its IUPAC name is 1,4,6-trimethyl-3-prop-2-enylpyrimidin-1-ium-2-one chloride.
| Compound Name | 1,4,6-trimethyl-3-prop-2-enylpyrimidin-1-ium-2-one chloride |
|---|---|
| PubChem CID | 68907368 |
| Molecular Formula | C10H15ClN2O |
| Molecular Weight | 214.70 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 1,4,6-trimethyl-3-prop-2-enylpyrimidin-1-ium-2-one chloride |
| SMILES | C=CCn1c(C)cc(C)[n+](C)c1=O.[Cl-] |
| InChI | InChI=1S/C10H15N2O.ClH/c1-5-6-12-9(3)7-8(2)11(4)10(12)13;/h5,7H,1,6H2,2-4H3;1H/q+1;/p-1 |
| InChIKey | FTRRKIZVQBRKGS-UHFFFAOYSA-M |
| XLogP | -2.52 |
| TPSA | 25.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.70 |
| LogP ≤ 5 | -2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|