1,4,6-trimethyl-3-prop-2-enylpyrimidin-1-ium-2-one chloride

C10H15ClN2O — CID 68907368

IUPAC1,4,6-trimethyl-3-prop-2-enylpyrimidin-1-ium-2-one chloride
SMILESC=CCn1c(C)cc(C)[n+](C)c1=O.[Cl-]
InChIInChI=1S/C10H15N2O.ClH/c1-5-6-12-9(3)7-8(2)11(4)10(12)13;/h5,7H,1,6H2,2-4H3;1H/q+1;/p-1
InChIKeyFTRRKIZVQBRKGS-UHFFFAOYSA-M
MW214.70 g/mol
LogP-2.52
Rot. Bonds2

About 1,4,6-trimethyl-3-prop-2-enylpyrimidin-1-ium-2-one chloride

1,4,6-trimethyl-3-prop-2-enylpyrimidin-1-ium-2-one chloride (PubChem CID 68907368) has the molecular formula C10H15ClN2O and a molecular weight of 214.70 g/mol. Its IUPAC name is 1,4,6-trimethyl-3-prop-2-enylpyrimidin-1-ium-2-one chloride.

Molecular Properties

Compound Name1,4,6-trimethyl-3-prop-2-enylpyrimidin-1-ium-2-one chloride
PubChem CID68907368
Molecular FormulaC10H15ClN2O
Molecular Weight214.70 g/mol
Exact Mass214.09
IUPAC Name1,4,6-trimethyl-3-prop-2-enylpyrimidin-1-ium-2-one chloride
SMILESC=CCn1c(C)cc(C)[n+](C)c1=O.[Cl-]
InChIInChI=1S/C10H15N2O.ClH/c1-5-6-12-9(3)7-8(2)11(4)10(12)13;/h5,7H,1,6H2,2-4H3;1H/q+1;/p-1
InChIKeyFTRRKIZVQBRKGS-UHFFFAOYSA-M
XLogP-2.52
TPSA25.88 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.70
LogP ≤ 5-2.52
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}

Analyze 1,4,6-trimethyl-3-prop-2-enylpyrimidin-1-ium-2-one chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,4,6-trimethyl-3-prop-2-enylpyrimidin-1-ium-2-one chloride?
The IUPAC name of 1,4,6-trimethyl-3-prop-2-enylpyrimidin-1-ium-2-one chloride (CID 68907368) is 1,4,6-trimethyl-3-prop-2-enylpyrimidin-1-ium-2-one chloride.
What is the SMILES notation for 1,4,6-trimethyl-3-prop-2-enylpyrimidin-1-ium-2-one chloride?
The canonical SMILES for 1,4,6-trimethyl-3-prop-2-enylpyrimidin-1-ium-2-one chloride is C=CCn1c(C)cc(C)[n+](C)c1=O.[Cl-].
What is the InChIKey of 1,4,6-trimethyl-3-prop-2-enylpyrimidin-1-ium-2-one chloride?
The InChIKey is FTRRKIZVQBRKGS-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H15N2O.ClH/c1-5-6-12-9(3)7-8(2)11(4)10(12)13;/h5,7H,1,6H2,2-4H3;1H/q+1;/p-1.
What are the key properties of 1,4,6-trimethyl-3-prop-2-enylpyrimidin-1-ium-2-one chloride?
1,4,6-trimethyl-3-prop-2-enylpyrimidin-1-ium-2-one chloride has a molecular weight of 214.70 g/mol, XLogP of -2.52, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4,6-trimethyl-3-prop-2-enylpyrimidin-1-ium-2-one chloride is sourced from PubChem (CID 68907368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).