C25H36BNO3 — CID 68907869
(2S,6R)-2,6-dimethyl-1-[2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]oxyethyl]piperidine (PubChem CID 68907869) has the molecular formula C25H36BNO3 and a molecular weight of 409.38 g/mol. Its IUPAC name is (2S,6R)-2,6-dimethyl-1-[2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]oxyethyl]piperidine.
| Compound Name | (2S,6R)-2,6-dimethyl-1-[2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]oxyethyl]piperidine |
|---|---|
| PubChem CID | 68907869 |
| Molecular Formula | C25H36BNO3 |
| Molecular Weight | 409.38 g/mol |
| Exact Mass | 409.28 |
| IUPAC Name | (2S,6R)-2,6-dimethyl-1-[2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]oxyethyl]piperidine |
| SMILES | C[C@@H]1CCC[C@H](C)N1CCOc1ccc2ccc(B3OC(C)(C)C(C)(C)O3)cc2c1 |
| InChI | InChI=1S/C25H36BNO3/c1-18-8-7-9-19(2)27(18)14-15-28-23-13-11-20-10-12-22(16-21(20)17-23)26-29-24(3,4)25(5,6)30-26/h10-13,16-19H,7-9,14-15H2,1-6H3/t18-,19+ |
| InChIKey | SHDRRQGDSXQOLS-KDURUIRLSA-N |
| XLogP | 4.78 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.38 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|