About (2-methoxyphenyl) octanoate
(2-methoxyphenyl) octanoate (PubChem CID 68908014) has the molecular formula C15H22O3
and a molecular weight of 250.34 g/mol. Its IUPAC name is (2-methoxyphenyl) octanoate.
Molecular Properties
| Compound Name | (2-methoxyphenyl) octanoate |
| PubChem CID | 68908014 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (2-methoxyphenyl) octanoate |
| SMILES | CCCCCCCC(=O)Oc1ccccc1OC |
| InChI | InChI=1S/C15H22O3/c1-3-4-5-6-7-12-15(16)18-14-11-9-8-10-13(14)17-2/h8-11H,3-7,12H2,1-2H3 |
| InChIKey | VRIGPZZVQHAMOT-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-methoxyphenyl) octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methoxyphenyl) octanoate?
The IUPAC name of (2-methoxyphenyl) octanoate (CID 68908014) is (2-methoxyphenyl) octanoate.
What is the SMILES notation for (2-methoxyphenyl) octanoate?
The canonical SMILES for (2-methoxyphenyl) octanoate is CCCCCCCC(=O)Oc1ccccc1OC.
What is the InChIKey of (2-methoxyphenyl) octanoate?
The InChIKey is VRIGPZZVQHAMOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O3/c1-3-4-5-6-7-12-15(16)18-14-11-9-8-10-13(14)17-2/h8-11H,3-7,12H2,1-2H3.
What are the key properties of (2-methoxyphenyl) octanoate?
(2-methoxyphenyl) octanoate has a molecular weight of 250.34 g/mol, XLogP of 3.96, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methoxyphenyl) octanoate is sourced from PubChem (CID 68908014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).