About [2-amino-6-[4-[(3-cyano-2-pyridinyl)amino]phenoxy]phenyl] propanoate;dihydrochloride
[2-amino-6-[4-[(3-cyano-2-pyridinyl)amino]phenoxy]phenyl] propanoate;dihydrochloride (PubChem CID 68908582) has the molecular formula C21H20Cl2N4O3
and a molecular weight of 447.32 g/mol. Its IUPAC name is [2-amino-6-[4-[(3-cyano-2-pyridinyl)amino]phenoxy]phenyl] propanoate;dihydrochloride.
Molecular Properties
| Compound Name | [2-amino-6-[4-[(3-cyano-2-pyridinyl)amino]phenoxy]phenyl] propanoate;dihydrochloride |
| PubChem CID | 68908582 |
| Molecular Formula | C21H20Cl2N4O3 |
| Molecular Weight | 447.32 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | [2-amino-6-[4-[(3-cyano-2-pyridinyl)amino]phenoxy]phenyl] propanoate;dihydrochloride |
| SMILES | CCC(=O)Oc1c(N)cccc1Oc1ccc(Nc2ncccc2C#N)cc1.Cl.Cl |
| InChI | InChI=1S/C21H18N4O3.2ClH/c1-2-19(26)28-20-17(23)6-3-7-18(20)27-16-10-8-15(9-11-16)25-21-14(13-22)5-4-12-24-21;;/h3-12H,2,23H2,1H3,(H,24,25);2*1H |
| InChIKey | HBXGLZUOCRYSJB-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.32 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-amino-6-[4-[(3-cyano-2-pyridinyl)amino]phenoxy]phenyl] propanoate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-amino-6-[4-[(3-cyano-2-pyridinyl)amino]phenoxy]phenyl] propanoate;dihydrochloride?
The IUPAC name of [2-amino-6-[4-[(3-cyano-2-pyridinyl)amino]phenoxy]phenyl] propanoate;dihydrochloride (CID 68908582) is [2-amino-6-[4-[(3-cyano-2-pyridinyl)amino]phenoxy]phenyl] propanoate;dihydrochloride.
What is the SMILES notation for [2-amino-6-[4-[(3-cyano-2-pyridinyl)amino]phenoxy]phenyl] propanoate;dihydrochloride?
The canonical SMILES for [2-amino-6-[4-[(3-cyano-2-pyridinyl)amino]phenoxy]phenyl] propanoate;dihydrochloride is CCC(=O)Oc1c(N)cccc1Oc1ccc(Nc2ncccc2C#N)cc1.Cl.Cl.
What is the InChIKey of [2-amino-6-[4-[(3-cyano-2-pyridinyl)amino]phenoxy]phenyl] propanoate;dihydrochloride?
The InChIKey is HBXGLZUOCRYSJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N4O3.2ClH/c1-2-19(26)28-20-17(23)6-3-7-18(20)27-16-10-8-15(9-11-16)25-21-14(13-22)5-4-12-24-21;;/h3-12H,2,23H2,1H3,(H,24,25);2*1H.
What are the key properties of [2-amino-6-[4-[(3-cyano-2-pyridinyl)amino]phenoxy]phenyl] propanoate;dihydrochloride?
[2-amino-6-[4-[(3-cyano-2-pyridinyl)amino]phenoxy]phenyl] propanoate;dihydrochloride has a molecular weight of 447.32 g/mol, XLogP of 5.23, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-amino-6-[4-[(3-cyano-2-pyridinyl)amino]phenoxy]phenyl] propanoate;dihydrochloride is sourced from PubChem (CID 68908582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).