C13H11N7O2S — CID 6890859
3-(5-methyl-1H-pyrazol-3-yl)-4-[(E)-(3-nitrophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 6890859) has the molecular formula C13H11N7O2S and a molecular weight of 329.35 g/mol. Its IUPAC name is 3-(5-methyl-1H-pyrazol-3-yl)-4-[(E)-(3-nitrophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(5-methyl-1H-pyrazol-3-yl)-4-[(E)-(3-nitrophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 6890859 |
| Molecular Formula | C13H11N7O2S |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 3-(5-methyl-1H-pyrazol-3-yl)-4-[(E)-(3-nitrophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1cc(-c2n[nH]c(=S)n2/N=C/c2cccc([N+](=O)[O-])c2)n[nH]1 |
| InChI | InChI=1S/C13H11N7O2S/c1-8-5-11(16-15-8)12-17-18-13(23)19(12)14-7-9-3-2-4-10(6-9)20(21)22/h2-7H,1H3,(H,15,16)(H,18,23)/b14-7+ |
| InChIKey | ACOMVPZJUCMYRR-VGOFMYFVSA-N |
| XLogP | 2.43 |
| TPSA | 117.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|