C7H12BrNO4 — CID 68909262
[(1R,2R,3R,4S)-2-bromo-3-hydroxy-4-(hydroxymethyl)cyclopentyl]carbamic acid (PubChem CID 68909262) has the molecular formula C7H12BrNO4 and a molecular weight of 254.08 g/mol. Its IUPAC name is [(1R,2R,3R,4S)-2-bromo-3-hydroxy-4-(hydroxymethyl)cyclopentyl]carbamic acid.
| Compound Name | [(1R,2R,3R,4S)-2-bromo-3-hydroxy-4-(hydroxymethyl)cyclopentyl]carbamic acid |
|---|---|
| PubChem CID | 68909262 |
| Molecular Formula | C7H12BrNO4 |
| Molecular Weight | 254.08 g/mol |
| Exact Mass | 252.99 |
| IUPAC Name | [(1R,2R,3R,4S)-2-bromo-3-hydroxy-4-(hydroxymethyl)cyclopentyl]carbamic acid |
| SMILES | O=C(O)N[C@@H]1C[C@@H](CO)[C@@H](O)[C@@H]1Br |
| InChI | InChI=1S/C7H12BrNO4/c8-5-4(9-7(12)13)1-3(2-10)6(5)11/h3-6,9-11H,1-2H2,(H,12,13)/t3-,4+,5+,6+/m0/s1 |
| InChIKey | JQCZFRNIVYZTOV-SLPGGIOYSA-N |
| XLogP | -0.24 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.08 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|