C17H25NO — CID 68909455
(1S,2S)-2-[methyl(3-phenylpropyl)amino]bicyclo[2.2.1]heptan-7-ol (PubChem CID 68909455) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is (1S,2S)-2-[methyl(3-phenylpropyl)amino]bicyclo[2.2.1]heptan-7-ol.
| Compound Name | (1S,2S)-2-[methyl(3-phenylpropyl)amino]bicyclo[2.2.1]heptan-7-ol |
|---|---|
| PubChem CID | 68909455 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | (1S,2S)-2-[methyl(3-phenylpropyl)amino]bicyclo[2.2.1]heptan-7-ol |
| SMILES | CN(CCCc1ccccc1)[C@H]1CC2CC[C@@H]1C2O |
| InChI | InChI=1S/C17H25NO/c1-18(11-5-8-13-6-3-2-4-7-13)16-12-14-9-10-15(16)17(14)19/h2-4,6-7,14-17,19H,5,8-12H2,1H3/t14?,15-,16-,17?/m0/s1 |
| InChIKey | ZCHDLFOJODUBCJ-YZUHTNEWSA-N |
| XLogP | 2.71 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |