C17H13FN4O — CID 6890964
N-[(E)-(3-fluorophenyl)methylideneamino]-3-phenyl-1H-pyrazole-5-carboxamide (PubChem CID 6890964) has the molecular formula C17H13FN4O and a molecular weight of 308.32 g/mol. Its IUPAC name is N-[(E)-(3-fluorophenyl)methylideneamino]-3-phenyl-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(E)-(3-fluorophenyl)methylideneamino]-3-phenyl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 6890964 |
| Molecular Formula | C17H13FN4O |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | N-[(E)-(3-fluorophenyl)methylideneamino]-3-phenyl-1H-pyrazole-5-carboxamide |
| SMILES | O=C(N/N=C/c1cccc(F)c1)c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C17H13FN4O/c18-14-8-4-5-12(9-14)11-19-22-17(23)16-10-15(20-21-16)13-6-2-1-3-7-13/h1-11H,(H,20,21)(H,22,23)/b19-11+ |
| InChIKey | CVYVIZQFDMJQAS-YBFXNURJSA-N |
| XLogP | 2.98 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|