C28H32Cl2N6O2 — CID 68910432
4-[[(4-tert-butylcyclohexyl)-[3-(2,6-dichlorophenyl)prop-2-enoyl]amino]methyl]-N-(2H-tetrazol-5-yl)benzamide (PubChem CID 68910432) has the molecular formula C28H32Cl2N6O2 and a molecular weight of 555.51 g/mol. Its IUPAC name is 4-[[(4-tert-butylcyclohexyl)-[3-(2,6-dichlorophenyl)prop-2-enoyl]amino]methyl]-N-(2H-tetrazol-5-yl)benzamide.
| Compound Name | 4-[[(4-tert-butylcyclohexyl)-[3-(2,6-dichlorophenyl)prop-2-enoyl]amino]methyl]-N-(2H-tetrazol-5-yl)benzamide |
|---|---|
| PubChem CID | 68910432 |
| Molecular Formula | C28H32Cl2N6O2 |
| Molecular Weight | 555.51 g/mol |
| Exact Mass | 554.20 |
| IUPAC Name | 4-[[(4-tert-butylcyclohexyl)-[3-(2,6-dichlorophenyl)prop-2-enoyl]amino]methyl]-N-(2H-tetrazol-5-yl)benzamide |
| SMILES | CC(C)(C)C1CCC(N(Cc2ccc(C(=O)Nc3nn[nH]n3)cc2)C(=O)C=Cc2c(Cl)cccc2Cl)CC1 |
| InChI | InChI=1S/C28H32Cl2N6O2/c1-28(2,3)20-11-13-21(14-12-20)36(25(37)16-15-22-23(29)5-4-6-24(22)30)17-18-7-9-19(10-8-18)26(38)31-27-32-34-35-33-27/h4-10,15-16,20-21H,11-14,17H2,1-3H3,(H2,31,32,33,34,35,38) |
| InChIKey | MPPUHOOIXTYOGZ-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.51 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|