About 1,2,3-triethyl-2H-quinoline
1,2,3-triethyl-2H-quinoline (PubChem CID 68910959) has the molecular formula C15H21N
and a molecular weight of 215.34 g/mol. Its IUPAC name is 1,2,3-triethyl-2H-quinoline.
Molecular Properties
| Compound Name | 1,2,3-triethyl-2H-quinoline |
| PubChem CID | 68910959 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 1,2,3-triethyl-2H-quinoline |
| SMILES | CCC1=Cc2ccccc2N(CC)C1CC |
| InChI | InChI=1S/C15H21N/c1-4-12-11-13-9-7-8-10-15(13)16(6-3)14(12)5-2/h7-11,14H,4-6H2,1-3H3 |
| InChIKey | FBJUFJVALWDJDM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,2,3-triethyl-2H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3-triethyl-2H-quinoline?
The IUPAC name of 1,2,3-triethyl-2H-quinoline (CID 68910959) is 1,2,3-triethyl-2H-quinoline.
What is the SMILES notation for 1,2,3-triethyl-2H-quinoline?
The canonical SMILES for 1,2,3-triethyl-2H-quinoline is CCC1=Cc2ccccc2N(CC)C1CC.
What is the InChIKey of 1,2,3-triethyl-2H-quinoline?
The InChIKey is FBJUFJVALWDJDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N/c1-4-12-11-13-9-7-8-10-15(13)16(6-3)14(12)5-2/h7-11,14H,4-6H2,1-3H3.
What are the key properties of 1,2,3-triethyl-2H-quinoline?
1,2,3-triethyl-2H-quinoline has a molecular weight of 215.34 g/mol, XLogP of 4.10, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3-triethyl-2H-quinoline is sourced from PubChem (CID 68910959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).