C23H34N2O3 — CID 68910962
4-[3-[(1R,5S)-3-(2-ethoxyethyl)-8-azabicyclo[3.2.1]octan-8-yl]-2-methylpropyl]-1,4-benzoxazin-3-one (PubChem CID 68910962) has the molecular formula C23H34N2O3 and a molecular weight of 386.54 g/mol. Its IUPAC name is 4-[3-[(1R,5S)-3-(2-ethoxyethyl)-8-azabicyclo[3.2.1]octan-8-yl]-2-methylpropyl]-1,4-benzoxazin-3-one.
| Compound Name | 4-[3-[(1R,5S)-3-(2-ethoxyethyl)-8-azabicyclo[3.2.1]octan-8-yl]-2-methylpropyl]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 68910962 |
| Molecular Formula | C23H34N2O3 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.26 |
| IUPAC Name | 4-[3-[(1R,5S)-3-(2-ethoxyethyl)-8-azabicyclo[3.2.1]octan-8-yl]-2-methylpropyl]-1,4-benzoxazin-3-one |
| SMILES | CCOCCC1C[C@H]2CC[C@@H](C1)N2CC(C)CN1C(=O)COc2ccccc21 |
| InChI | InChI=1S/C23H34N2O3/c1-3-27-11-10-18-12-19-8-9-20(13-18)24(19)14-17(2)15-25-21-6-4-5-7-22(21)28-16-23(25)26/h4-7,17-20H,3,8-16H2,1-2H3/t17?,18?,19-,20+ |
| InChIKey | MFEAWMDTZJPYRO-KHSMEXAKSA-N |
| XLogP | 3.72 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|