C11H21N — CID 68911417
(1R,3R,5R)-3-ethenyl-1,3,5-trimethylcyclohexan-1-amine (PubChem CID 68911417) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is (1R,3R,5R)-3-ethenyl-1,3,5-trimethylcyclohexan-1-amine.
| Compound Name | (1R,3R,5R)-3-ethenyl-1,3,5-trimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 68911417 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | (1R,3R,5R)-3-ethenyl-1,3,5-trimethylcyclohexan-1-amine |
| SMILES | C=C[C@]1(C)C[C@@H](C)C[C@@](C)(N)C1 |
| InChI | InChI=1S/C11H21N/c1-5-10(3)6-9(2)7-11(4,12)8-10/h5,9H,1,6-8,12H2,2-4H3/t9-,10-,11-/m1/s1 |
| InChIKey | MTNDMAWJUIRFFT-GMTAPVOTSA-N |
| XLogP | 2.72 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|