C25H24F3N3O5 — CID 68911551
[2,2-dimethyl-7-[(E)-3-[methyl-[(3-methyl-1-benzofuran-2-yl)methyl]amino]-3-oxoprop-1-enyl]-3,4-dihydropyrido[3,2-b][1,4]oxazin-3-yl] 2,2,2-trifluoroacetate (PubChem CID 68911551) has the molecular formula C25H24F3N3O5 and a molecular weight of 503.48 g/mol. Its IUPAC name is [2,2-dimethyl-7-[(E)-3-[methyl-[(3-methyl-1-benzofuran-2-yl)methyl]amino]-3-oxoprop-1-enyl]-3,4-dihydropyrido[3,2-b][1,4]oxazin-3-yl] 2,2,2-trifluoroacetate.
| Compound Name | [2,2-dimethyl-7-[(E)-3-[methyl-[(3-methyl-1-benzofuran-2-yl)methyl]amino]-3-oxoprop-1-enyl]-3,4-dihydropyrido[3,2-b][1,4]oxazin-3-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 68911551 |
| Molecular Formula | C25H24F3N3O5 |
| Molecular Weight | 503.48 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | [2,2-dimethyl-7-[(E)-3-[methyl-[(3-methyl-1-benzofuran-2-yl)methyl]amino]-3-oxoprop-1-enyl]-3,4-dihydropyrido[3,2-b][1,4]oxazin-3-yl] 2,2,2-trifluoroacetate |
| SMILES | Cc1c(CN(C)C(=O)/C=C/c2cnc3c(c2)OC(C)(C)C(OC(=O)C(F)(F)F)N3)oc2ccccc12 |
| InChI | InChI=1S/C25H24F3N3O5/c1-14-16-7-5-6-8-17(16)34-19(14)13-31(4)20(32)10-9-15-11-18-21(29-12-15)30-22(24(2,3)36-18)35-23(33)25(26,27)28/h5-12,22H,13H2,1-4H3,(H,29,30)/b10-9+ |
| InChIKey | YBYNPSVMTAAVBX-MDZDMXLPSA-N |
| XLogP | 4.82 |
| TPSA | 93.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.48 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|