About ethyl 2-[(N'-methylcarbamimidoyl)amino]cyclohexane-1-carboxylate
ethyl 2-[(N'-methylcarbamimidoyl)amino]cyclohexane-1-carboxylate (PubChem CID 68912343) has the molecular formula C11H21N3O2
and a molecular weight of 227.31 g/mol. Its IUPAC name is ethyl 2-[(N'-methylcarbamimidoyl)amino]cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-[(N'-methylcarbamimidoyl)amino]cyclohexane-1-carboxylate |
| PubChem CID | 68912343 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | ethyl 2-[(N'-methylcarbamimidoyl)amino]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCCCC1N/C(N)=N/C |
| InChI | InChI=1S/C11H21N3O2/c1-3-16-10(15)8-6-4-5-7-9(8)14-11(12)13-2/h8-9H,3-7H2,1-2H3,(H3,12,13,14) |
| InChIKey | UEXOCSLWOWUBCR-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[(N'-methylcarbamimidoyl)amino]cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(N'-methylcarbamimidoyl)amino]cyclohexane-1-carboxylate?
The IUPAC name of ethyl 2-[(N'-methylcarbamimidoyl)amino]cyclohexane-1-carboxylate (CID 68912343) is ethyl 2-[(N'-methylcarbamimidoyl)amino]cyclohexane-1-carboxylate.
What is the SMILES notation for ethyl 2-[(N'-methylcarbamimidoyl)amino]cyclohexane-1-carboxylate?
The canonical SMILES for ethyl 2-[(N'-methylcarbamimidoyl)amino]cyclohexane-1-carboxylate is CCOC(=O)C1CCCCC1N/C(N)=N/C.
What is the InChIKey of ethyl 2-[(N'-methylcarbamimidoyl)amino]cyclohexane-1-carboxylate?
The InChIKey is UEXOCSLWOWUBCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3O2/c1-3-16-10(15)8-6-4-5-7-9(8)14-11(12)13-2/h8-9H,3-7H2,1-2H3,(H3,12,13,14).
What are the key properties of ethyl 2-[(N'-methylcarbamimidoyl)amino]cyclohexane-1-carboxylate?
ethyl 2-[(N'-methylcarbamimidoyl)amino]cyclohexane-1-carboxylate has a molecular weight of 227.31 g/mol, XLogP of 0.64, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(N'-methylcarbamimidoyl)amino]cyclohexane-1-carboxylate is sourced from PubChem (CID 68912343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).