About tert-butyl-[[(3R,4S)-4-(2-fluorophenyl)pyrrolidin-3-yl]methoxy]-dimethylsilane
tert-butyl-[[(3R,4S)-4-(2-fluorophenyl)pyrrolidin-3-yl]methoxy]-dimethylsilane (PubChem CID 68912480) has the molecular formula C17H28FNOSi
and a molecular weight of 309.50 g/mol. Its IUPAC name is tert-butyl-[[(3R,4S)-4-(2-fluorophenyl)pyrrolidin-3-yl]methoxy]-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-[[(3R,4S)-4-(2-fluorophenyl)pyrrolidin-3-yl]methoxy]-dimethylsilane |
| PubChem CID | 68912480 |
| Molecular Formula | C17H28FNOSi |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | tert-butyl-[[(3R,4S)-4-(2-fluorophenyl)pyrrolidin-3-yl]methoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1CNC[C@@H]1c1ccccc1F |
| InChI | InChI=1S/C17H28FNOSi/c1-17(2,3)21(4,5)20-12-13-10-19-11-15(13)14-8-6-7-9-16(14)18/h6-9,13,15,19H,10-12H2,1-5H3/t13-,15+/m1/s1 |
| InChIKey | USRAEKRTFFCGDQ-HIFRSBDPSA-N |
| XLogP | 4.15 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[[(3R,4S)-4-(2-fluorophenyl)pyrrolidin-3-yl]methoxy]-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[[(3R,4S)-4-(2-fluorophenyl)pyrrolidin-3-yl]methoxy]-dimethylsilane?
The IUPAC name of tert-butyl-[[(3R,4S)-4-(2-fluorophenyl)pyrrolidin-3-yl]methoxy]-dimethylsilane (CID 68912480) is tert-butyl-[[(3R,4S)-4-(2-fluorophenyl)pyrrolidin-3-yl]methoxy]-dimethylsilane.
What is the SMILES notation for tert-butyl-[[(3R,4S)-4-(2-fluorophenyl)pyrrolidin-3-yl]methoxy]-dimethylsilane?
The canonical SMILES for tert-butyl-[[(3R,4S)-4-(2-fluorophenyl)pyrrolidin-3-yl]methoxy]-dimethylsilane is CC(C)(C)[Si](C)(C)OC[C@H]1CNC[C@@H]1c1ccccc1F.
What is the InChIKey of tert-butyl-[[(3R,4S)-4-(2-fluorophenyl)pyrrolidin-3-yl]methoxy]-dimethylsilane?
The InChIKey is USRAEKRTFFCGDQ-HIFRSBDPSA-N. The full InChI is InChI=1S/C17H28FNOSi/c1-17(2,3)21(4,5)20-12-13-10-19-11-15(13)14-8-6-7-9-16(14)18/h6-9,13,15,19H,10-12H2,1-5H3/t13-,15+/m1/s1.
What are the key properties of tert-butyl-[[(3R,4S)-4-(2-fluorophenyl)pyrrolidin-3-yl]methoxy]-dimethylsilane?
tert-butyl-[[(3R,4S)-4-(2-fluorophenyl)pyrrolidin-3-yl]methoxy]-dimethylsilane has a molecular weight of 309.50 g/mol, XLogP of 4.15, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[[(3R,4S)-4-(2-fluorophenyl)pyrrolidin-3-yl]methoxy]-dimethylsilane is sourced from PubChem (CID 68912480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).