About [(3R,4S)-1-benzyl-4-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]methanol
[(3R,4S)-1-benzyl-4-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]methanol (PubChem CID 68912746) has the molecular formula C19H20F3NO
and a molecular weight of 335.37 g/mol. Its IUPAC name is [(3R,4S)-1-benzyl-4-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]methanol.
Molecular Properties
| Compound Name | [(3R,4S)-1-benzyl-4-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]methanol |
| PubChem CID | 68912746 |
| Molecular Formula | C19H20F3NO |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | [(3R,4S)-1-benzyl-4-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]methanol |
| SMILES | OC[C@H]1CN(Cc2ccccc2)C[C@@H]1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H20F3NO/c20-19(21,22)17-8-4-7-15(9-17)18-12-23(11-16(18)13-24)10-14-5-2-1-3-6-14/h1-9,16,18,24H,10-13H2/t16-,18-/m1/s1 |
| InChIKey | YYLMMETVYLRMLX-SJLPKXTDSA-N |
| XLogP | 3.91 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(3R,4S)-1-benzyl-4-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4S)-1-benzyl-4-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]methanol?
The IUPAC name of [(3R,4S)-1-benzyl-4-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]methanol (CID 68912746) is [(3R,4S)-1-benzyl-4-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]methanol.
What is the SMILES notation for [(3R,4S)-1-benzyl-4-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]methanol?
The canonical SMILES for [(3R,4S)-1-benzyl-4-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]methanol is OC[C@H]1CN(Cc2ccccc2)C[C@@H]1c1cccc(C(F)(F)F)c1.
What is the InChIKey of [(3R,4S)-1-benzyl-4-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]methanol?
The InChIKey is YYLMMETVYLRMLX-SJLPKXTDSA-N. The full InChI is InChI=1S/C19H20F3NO/c20-19(21,22)17-8-4-7-15(9-17)18-12-23(11-16(18)13-24)10-14-5-2-1-3-6-14/h1-9,16,18,24H,10-13H2/t16-,18-/m1/s1.
What are the key properties of [(3R,4S)-1-benzyl-4-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]methanol?
[(3R,4S)-1-benzyl-4-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]methanol has a molecular weight of 335.37 g/mol, XLogP of 3.91, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4S)-1-benzyl-4-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]methanol is sourced from PubChem (CID 68912746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).