C24H31NO5S — CID 68912988
4-(2-methoxyphenyl)-1-[2-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)ethyl]piperidine;oxalic acid (PubChem CID 68912988) has the molecular formula C24H31NO5S and a molecular weight of 445.58 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)-1-[2-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)ethyl]piperidine;oxalic acid.
| Compound Name | 4-(2-methoxyphenyl)-1-[2-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)ethyl]piperidine;oxalic acid |
|---|---|
| PubChem CID | 68912988 |
| Molecular Formula | C24H31NO5S |
| Molecular Weight | 445.58 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 4-(2-methoxyphenyl)-1-[2-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)ethyl]piperidine;oxalic acid |
| SMILES | COc1ccccc1C1CCN(CCC2CCCc3sccc32)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H29NOS.C2H2O4/c1-24-21-7-3-2-6-19(21)18-10-14-23(15-11-18)13-9-17-5-4-8-22-20(17)12-16-25-22;3-1(4)2(5)6/h2-3,6-7,12,16-18H,4-5,8-11,13-15H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | AWBNJOPWQPPAHF-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.58 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|