About 4-benzyl-6-(2,4-dimethoxypyrimidin-5-yl)pyrido[3,2-d]pyrimidin-2-amine
4-benzyl-6-(2,4-dimethoxypyrimidin-5-yl)pyrido[3,2-d]pyrimidin-2-amine (PubChem CID 68913046) has the molecular formula C20H18N6O2
and a molecular weight of 374.40 g/mol. Its IUPAC name is 4-benzyl-6-(2,4-dimethoxypyrimidin-5-yl)pyrido[3,2-d]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-benzyl-6-(2,4-dimethoxypyrimidin-5-yl)pyrido[3,2-d]pyrimidin-2-amine |
| PubChem CID | 68913046 |
| Molecular Formula | C20H18N6O2 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 4-benzyl-6-(2,4-dimethoxypyrimidin-5-yl)pyrido[3,2-d]pyrimidin-2-amine |
| SMILES | COc1ncc(-c2ccc3nc(N)nc(Cc4ccccc4)c3n2)c(OC)n1 |
| InChI | InChI=1S/C20H18N6O2/c1-27-18-13(11-22-20(26-18)28-2)14-8-9-15-17(23-14)16(25-19(21)24-15)10-12-6-4-3-5-7-12/h3-9,11H,10H2,1-2H3,(H2,21,24,25) |
| InChIKey | RUDSNPNRZSRQGV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 108.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 4-benzyl-6-(2,4-dimethoxypyrimidin-5-yl)pyrido[3,2-d]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-6-(2,4-dimethoxypyrimidin-5-yl)pyrido[3,2-d]pyrimidin-2-amine?
The IUPAC name of 4-benzyl-6-(2,4-dimethoxypyrimidin-5-yl)pyrido[3,2-d]pyrimidin-2-amine (CID 68913046) is 4-benzyl-6-(2,4-dimethoxypyrimidin-5-yl)pyrido[3,2-d]pyrimidin-2-amine.
What is the SMILES notation for 4-benzyl-6-(2,4-dimethoxypyrimidin-5-yl)pyrido[3,2-d]pyrimidin-2-amine?
The canonical SMILES for 4-benzyl-6-(2,4-dimethoxypyrimidin-5-yl)pyrido[3,2-d]pyrimidin-2-amine is COc1ncc(-c2ccc3nc(N)nc(Cc4ccccc4)c3n2)c(OC)n1.
What is the InChIKey of 4-benzyl-6-(2,4-dimethoxypyrimidin-5-yl)pyrido[3,2-d]pyrimidin-2-amine?
The InChIKey is RUDSNPNRZSRQGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N6O2/c1-27-18-13(11-22-20(26-18)28-2)14-8-9-15-17(23-14)16(25-19(21)24-15)10-12-6-4-3-5-7-12/h3-9,11H,10H2,1-2H3,(H2,21,24,25).
What are the key properties of 4-benzyl-6-(2,4-dimethoxypyrimidin-5-yl)pyrido[3,2-d]pyrimidin-2-amine?
4-benzyl-6-(2,4-dimethoxypyrimidin-5-yl)pyrido[3,2-d]pyrimidin-2-amine has a molecular weight of 374.40 g/mol, XLogP of 2.67, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-6-(2,4-dimethoxypyrimidin-5-yl)pyrido[3,2-d]pyrimidin-2-amine is sourced from PubChem (CID 68913046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).