C17H18N4S — CID 68913093
6-(2-methylsulfanylphenyl)-4-propylpyrido[3,2-d]pyrimidin-2-amine (PubChem CID 68913093) has the molecular formula C17H18N4S and a molecular weight of 310.43 g/mol. Its IUPAC name is 6-(2-methylsulfanylphenyl)-4-propylpyrido[3,2-d]pyrimidin-2-amine.
| Compound Name | 6-(2-methylsulfanylphenyl)-4-propylpyrido[3,2-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 68913093 |
| Molecular Formula | C17H18N4S |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 6-(2-methylsulfanylphenyl)-4-propylpyrido[3,2-d]pyrimidin-2-amine |
| SMILES | CCCc1nc(N)nc2ccc(-c3ccccc3SC)nc12 |
| InChI | InChI=1S/C17H18N4S/c1-3-6-13-16-14(21-17(18)20-13)10-9-12(19-16)11-7-4-5-8-15(11)22-2/h4-5,7-10H,3,6H2,1-2H3,(H2,18,20,21) |
| InChIKey | JIVCSBUOZMEKEI-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |