About 3-(2-amino-4-phenylpyrido[3,2-d]pyrimidin-6-yl)-N,N-dimethylbenzamide
3-(2-amino-4-phenylpyrido[3,2-d]pyrimidin-6-yl)-N,N-dimethylbenzamide (PubChem CID 68913326) has the molecular formula C22H19N5O
and a molecular weight of 369.43 g/mol. Its IUPAC name is 3-(2-amino-4-phenylpyrido[3,2-d]pyrimidin-6-yl)-N,N-dimethylbenzamide.
Molecular Properties
| Compound Name | 3-(2-amino-4-phenylpyrido[3,2-d]pyrimidin-6-yl)-N,N-dimethylbenzamide |
| PubChem CID | 68913326 |
| Molecular Formula | C22H19N5O |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 3-(2-amino-4-phenylpyrido[3,2-d]pyrimidin-6-yl)-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(-c2ccc3nc(N)nc(-c4ccccc4)c3n2)c1 |
| InChI | InChI=1S/C22H19N5O/c1-27(2)21(28)16-10-6-9-15(13-16)17-11-12-18-20(24-17)19(26-22(23)25-18)14-7-4-3-5-8-14/h3-13H,1-2H3,(H2,23,25,26) |
| InChIKey | RMYQCXLIQHNGFQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 85.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(2-amino-4-phenylpyrido[3,2-d]pyrimidin-6-yl)-N,N-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-amino-4-phenylpyrido[3,2-d]pyrimidin-6-yl)-N,N-dimethylbenzamide?
The IUPAC name of 3-(2-amino-4-phenylpyrido[3,2-d]pyrimidin-6-yl)-N,N-dimethylbenzamide (CID 68913326) is 3-(2-amino-4-phenylpyrido[3,2-d]pyrimidin-6-yl)-N,N-dimethylbenzamide.
What is the SMILES notation for 3-(2-amino-4-phenylpyrido[3,2-d]pyrimidin-6-yl)-N,N-dimethylbenzamide?
The canonical SMILES for 3-(2-amino-4-phenylpyrido[3,2-d]pyrimidin-6-yl)-N,N-dimethylbenzamide is CN(C)C(=O)c1cccc(-c2ccc3nc(N)nc(-c4ccccc4)c3n2)c1.
What is the InChIKey of 3-(2-amino-4-phenylpyrido[3,2-d]pyrimidin-6-yl)-N,N-dimethylbenzamide?
The InChIKey is RMYQCXLIQHNGFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19N5O/c1-27(2)21(28)16-10-6-9-15(13-16)17-11-12-18-20(24-17)19(26-22(23)25-18)14-7-4-3-5-8-14/h3-13H,1-2H3,(H2,23,25,26).
What are the key properties of 3-(2-amino-4-phenylpyrido[3,2-d]pyrimidin-6-yl)-N,N-dimethylbenzamide?
3-(2-amino-4-phenylpyrido[3,2-d]pyrimidin-6-yl)-N,N-dimethylbenzamide has a molecular weight of 369.43 g/mol, XLogP of 3.64, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-amino-4-phenylpyrido[3,2-d]pyrimidin-6-yl)-N,N-dimethylbenzamide is sourced from PubChem (CID 68913326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).