C19H19N3O2 — CID 68913590
2-N-(4-ethoxy-2,3-dihydro-1-benzofuran-3-yl)quinoline-2,6-diamine (PubChem CID 68913590) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is 2-N-(4-ethoxy-2,3-dihydro-1-benzofuran-3-yl)quinoline-2,6-diamine.
| Compound Name | 2-N-(4-ethoxy-2,3-dihydro-1-benzofuran-3-yl)quinoline-2,6-diamine |
|---|---|
| PubChem CID | 68913590 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 2-N-(4-ethoxy-2,3-dihydro-1-benzofuran-3-yl)quinoline-2,6-diamine |
| SMILES | CCOc1cccc2c1C(Nc1ccc3cc(N)ccc3n1)CO2 |
| InChI | InChI=1S/C19H19N3O2/c1-2-23-16-4-3-5-17-19(16)15(11-24-17)22-18-9-6-12-10-13(20)7-8-14(12)21-18/h3-10,15H,2,11,20H2,1H3,(H,21,22) |
| InChIKey | BWNQDQMAMSSRDI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|