About [(3R,4S)-1-benzyl-4-(3-fluorophenyl)pyrrolidin-3-yl]methoxy-tert-butyl-dimethylsilane
[(3R,4S)-1-benzyl-4-(3-fluorophenyl)pyrrolidin-3-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 68913625) has the molecular formula C24H34FNOSi
and a molecular weight of 399.63 g/mol. Its IUPAC name is [(3R,4S)-1-benzyl-4-(3-fluorophenyl)pyrrolidin-3-yl]methoxy-tert-butyl-dimethylsilane.
Molecular Properties
| Compound Name | [(3R,4S)-1-benzyl-4-(3-fluorophenyl)pyrrolidin-3-yl]methoxy-tert-butyl-dimethylsilane |
| PubChem CID | 68913625 |
| Molecular Formula | C24H34FNOSi |
| Molecular Weight | 399.63 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | [(3R,4S)-1-benzyl-4-(3-fluorophenyl)pyrrolidin-3-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1CN(Cc2ccccc2)C[C@@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C24H34FNOSi/c1-24(2,3)28(4,5)27-18-21-16-26(15-19-10-7-6-8-11-19)17-23(21)20-12-9-13-22(25)14-20/h6-14,21,23H,15-18H2,1-5H3/t21-,23-/m1/s1 |
| InChIKey | UPLLRHMQYGRWHH-FYYLOGMGSA-N |
| XLogP | 6.06 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.63 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(3R,4S)-1-benzyl-4-(3-fluorophenyl)pyrrolidin-3-yl]methoxy-tert-butyl-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4S)-1-benzyl-4-(3-fluorophenyl)pyrrolidin-3-yl]methoxy-tert-butyl-dimethylsilane?
The IUPAC name of [(3R,4S)-1-benzyl-4-(3-fluorophenyl)pyrrolidin-3-yl]methoxy-tert-butyl-dimethylsilane (CID 68913625) is [(3R,4S)-1-benzyl-4-(3-fluorophenyl)pyrrolidin-3-yl]methoxy-tert-butyl-dimethylsilane.
What is the SMILES notation for [(3R,4S)-1-benzyl-4-(3-fluorophenyl)pyrrolidin-3-yl]methoxy-tert-butyl-dimethylsilane?
The canonical SMILES for [(3R,4S)-1-benzyl-4-(3-fluorophenyl)pyrrolidin-3-yl]methoxy-tert-butyl-dimethylsilane is CC(C)(C)[Si](C)(C)OC[C@H]1CN(Cc2ccccc2)C[C@@H]1c1cccc(F)c1.
What is the InChIKey of [(3R,4S)-1-benzyl-4-(3-fluorophenyl)pyrrolidin-3-yl]methoxy-tert-butyl-dimethylsilane?
The InChIKey is UPLLRHMQYGRWHH-FYYLOGMGSA-N. The full InChI is InChI=1S/C24H34FNOSi/c1-24(2,3)28(4,5)27-18-21-16-26(15-19-10-7-6-8-11-19)17-23(21)20-12-9-13-22(25)14-20/h6-14,21,23H,15-18H2,1-5H3/t21-,23-/m1/s1.
What are the key properties of [(3R,4S)-1-benzyl-4-(3-fluorophenyl)pyrrolidin-3-yl]methoxy-tert-butyl-dimethylsilane?
[(3R,4S)-1-benzyl-4-(3-fluorophenyl)pyrrolidin-3-yl]methoxy-tert-butyl-dimethylsilane has a molecular weight of 399.63 g/mol, XLogP of 6.06, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4S)-1-benzyl-4-(3-fluorophenyl)pyrrolidin-3-yl]methoxy-tert-butyl-dimethylsilane is sourced from PubChem (CID 68913625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).