About 4-[(2-tert-butyl-4-methylphenoxy)methyl]-2,2-dimethyl-1,3-dioxolane
4-[(2-tert-butyl-4-methylphenoxy)methyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 68913818) has the molecular formula C17H26O3
and a molecular weight of 278.39 g/mol. Its IUPAC name is 4-[(2-tert-butyl-4-methylphenoxy)methyl]-2,2-dimethyl-1,3-dioxolane.
Molecular Properties
| Compound Name | 4-[(2-tert-butyl-4-methylphenoxy)methyl]-2,2-dimethyl-1,3-dioxolane |
| PubChem CID | 68913818 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 4-[(2-tert-butyl-4-methylphenoxy)methyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | Cc1ccc(OCC2COC(C)(C)O2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C17H26O3/c1-12-7-8-15(14(9-12)16(2,3)4)18-10-13-11-19-17(5,6)20-13/h7-9,13H,10-11H2,1-6H3 |
| InChIKey | CWMSYZIPLSGPBI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(2-tert-butyl-4-methylphenoxy)methyl]-2,2-dimethyl-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-tert-butyl-4-methylphenoxy)methyl]-2,2-dimethyl-1,3-dioxolane?
The IUPAC name of 4-[(2-tert-butyl-4-methylphenoxy)methyl]-2,2-dimethyl-1,3-dioxolane (CID 68913818) is 4-[(2-tert-butyl-4-methylphenoxy)methyl]-2,2-dimethyl-1,3-dioxolane.
What is the SMILES notation for 4-[(2-tert-butyl-4-methylphenoxy)methyl]-2,2-dimethyl-1,3-dioxolane?
The canonical SMILES for 4-[(2-tert-butyl-4-methylphenoxy)methyl]-2,2-dimethyl-1,3-dioxolane is Cc1ccc(OCC2COC(C)(C)O2)c(C(C)(C)C)c1.
What is the InChIKey of 4-[(2-tert-butyl-4-methylphenoxy)methyl]-2,2-dimethyl-1,3-dioxolane?
The InChIKey is CWMSYZIPLSGPBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26O3/c1-12-7-8-15(14(9-12)16(2,3)4)18-10-13-11-19-17(5,6)20-13/h7-9,13H,10-11H2,1-6H3.
What are the key properties of 4-[(2-tert-butyl-4-methylphenoxy)methyl]-2,2-dimethyl-1,3-dioxolane?
4-[(2-tert-butyl-4-methylphenoxy)methyl]-2,2-dimethyl-1,3-dioxolane has a molecular weight of 278.39 g/mol, XLogP of 3.82, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-tert-butyl-4-methylphenoxy)methyl]-2,2-dimethyl-1,3-dioxolane is sourced from PubChem (CID 68913818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).